PEG Phosphonate

PEG Phosphonate

BroadPharm provides monofunctional or heterobifunctional PEG Phosphonate or PEG Phosphonic acids with various active groups.

Catalog Product Name Structure M.W. Purity Pricing
PEG-bis(phosphonic acid)
BP-21701PEG2-bis(phosphonic acid)278.198%Pricing
BP-21707PEG3-bis(phosphonic acid)322.298%Pricing
PEG-bis-(ethyl phosphonate)
BP-21706PEG3-bis-(ethyl phosphonate)434.498%Pricing
BP-21700PEG5-bis-(ethyl phosphonate)522.598%Pricing
Azido-PEG-phosphonic acid
BP-23162Azido-PEG3-phosphonic acid283.298%Pricing
Azido-PEG-phosphonic acid ethyl ester
BP-23160Azido-PEG3-phosphonic acid ethyl ester339.398%Pricing
Bromo-PEG-phosphonic acid
BP-21709Bromo-PEG2-phosphonic acid277.198%Pricing
BP-21732Bromo-PEG3-phosphonic acid321.198%Pricing
BP-21731Bromo-PEG5-phosphonic acid409.298%Pricing
Bromo-PEG-phosphonic acid diethyl ester
BP-21708Bromo-PEG2-phosphonic acid diethyl ester333.298%Pricing
BP-21703Bromo-PEG3-phosphonic acid diethyl ester377.298%Pricing
BP-21702Bromo-PEG5-phosphonic acid diethyl ester465.398%Pricing
Carboxy-PEG-phosphonic acid
BP-23289Carboxy-PEG4-phosphonic acid330.398%Pricing
Carboxy-PEG-phosphonic acid ethyl ester
BP-23271Carboxy-PEG4-phosphonic acid ethyl ester386.498%Pricing
t-butyoxycarboxy-PEG-phosphonic acid ethyl ester
BP-24061t-butyoxycarboxy-PEG4-phosphonic acid ethyl ester442.598%Pricing
Diethoxy-phosphorylethyl-PEG-ethylphosphonic acid
BP-21710Diethoxy-phosphorylethyl-PEG5-ethylphosphonic acid466.498%Pricing
m-PEG-phosphonic acid
BP-22757m-PEG2-phosphonic acid184.198%Pricing
BP-23119m-PEG4-phosphonic acid272.298%Pricing
BP-22758m-PEG5-phosphonic acid316.398%Pricing
BP-22759m-PEG9-phosphonic acid492.598%Pricing
m-PEG-(CH2)-phosphonic acid
BP-23361m-PEG4-(CH2)8-phosphonic acid356.496%Pricing
BP-23365m-PEG6-(CH2)8-phosphonic acid444.596%Pricing
BP-23520m-PEG8-(CH2)12-phosphonic acid588.798%Pricing
m-PEG-phosphonic acid ethyl ester
BP-23118m-PEG4-phosphonic acid ethyl ester328.398%Pricing
BP-22772m-PEG5-phosphonic acid ethyl ester372.498%Pricing
BP-22773m-PEG9-phosphonic acid ethyl ester548.698%Pricing
m-PEG-(CH2)-phosphonic acid ethyl ester
BP-23362m-PEG4-(CH2)8-phosphonic acid ethyl ester412.596%Pricing
BP-23364m-PEG6-(CH2)8-phosphonic acid ethyl ester500.696%Pricing
BP-23643m-PEG8-(CH2)12-phosphonic acid ethyl ester644.898%Pricing
Propargyl-PEG-phosphonic acid
BP-23272Propargyl-PEG3-phosphonic acid252.298%Pricing
Propargyl-PEG-phosphonic acid ethyl ester
BP-23752Propargyl-PEG3-phosphonic acid ethyl ester308.398%Pricing
PEG-bis(phosphonic acid diethyl ester)
BP-21813PEG3-bis(phosphonic acid diethyl ester)378.398%Pricing
BP-21812PEG4-bis(phosphonic acid diethyl ester)422.498%Pricing
BP-21587PEG5-bis(phosphonic acid diethyl ester)466.498%Pricing
(Diethoxy-phosphorylamino)-ethyl-phosphoramidic acid diethyl ester
BP-21726[2-(Diethoxy-phosphorylamino)-ethyl]-phosphoramidic acid diethyl ester332.398%Pricing
BP-21722[4-(Diethoxy-phosphorylamino)-butyl]-phosphoramidic acid diethyl ester360.398%Pricing
BP-21723[6-(Diethoxy-phosphorylamino)-hexyl]-phosphoramidic acid diethyl ester388.496%Pricing
BP-21705Tetraethyl butane-1,4-diylbis(phosphonate)330.398%Pricing
BP-21693Tetraethyl heptane-1,7-diylbis(phosphonate)372.498%Pricing
BP-21692Tetraethyl octane-1,8-diylbis(phosphonate)386.498%Pricing
BP-21735Tetraethyl decane-1,10-diylbis(phosphonate)414.596%Pricing
Phosphonic acid
BP-21704Butane-1,4-diyldiphosphonic acid218.198%Pricing
BP-21699Hexane-1,6-diyldiphosphonic acid246.198%Pricing
BP-21730[10-(Diethoxy-phosphoryl)-decyl]-phosphonic acid358.498%Pricing
Bromo-phosphonic acid
BP-217344-bromobutylphosphonic acid21797%Pricing
BP-217126-Bromohexylphosphonic acid245.198%Pricing
BP-2172810-bromodecylphosphonic acid301.298%Pricing
BP-21711diethyl 4-bromobutylphosphonate273.198%Pricing
BP-21694diethyl 7-bromoheptylphosphonate315.298%Pricing
BP-21689diethyl 8-bromooctylphosphonate329.298%Pricing
BP-21729diethyl 10-bromodecylphosphonate357.398%Pricing
BP-23607diethyl 12-bromodecylphosphonate385.398%Pricing