Hydroxy PEG

Hydroxy PEG

BroadPharm provides monofunctional or heterobifunctional hydroxyl PEGs (PEG Alcohols) with various active groups, including Alkyne, carboxylic acid, NHS ester, PFP ester, Tosyl, Amine, Azide, Bromide, etc.

Catalog Product Name Structure M.W. Purity Pricing
BP-23136Hydroxy-PEG2-acid sodium saltMolecular structure of the compound: Hydroxy-PEG2-acid sodium salt200.295%Pricing
BP-25119Hydroxy-PEG4-acid sodium saltMolecular structure of the compound: Hydroxy-PEG4-acid sodium salt288.395%Pricing
BP-25145Hydroxy-PEG8-acid sodium saltMolecular structure of the compound: Hydroxy-PEG8-acid sodium salt464.596%Pricing
BP-24490Hydroxy-PEG10-acid sodium saltMolecular structure of the compound: Hydroxy-PEG10-acid sodium salt552.695%Pricing
BP-22783Hydroxy-PEG2-CH2CO2H sodium saltMolecular structure of the compound: Hydroxy-PEG2-CH2CO2H sodium salt164.298%Pricing
BP-23621Hydroxy-PEG4-CH2CO2H sodium saltMolecular structure of the compound: Hydroxy-PEG4-CH2CO2H sodium salt252.397%Pricing
Hydroxy-PEG-t-butyl ester
BP-20597Hydroxy-PEG1-t-butyl esterMolecular structure of the compound: Hydroxy-PEG1-t-butyl ester190.298%Pricing
BP-20520Hydroxy-PEG2-t-butyl esterMolecular structure of the compound: Hydroxy-PEG2-t-butyl ester234.398%Pricing
BP-20633Hydroxy-PEG3-t-butyl esterMolecular structure of the compound: Hydroxy-PEG3-t-butyl ester278.398%Pricing
BP-20402Hydroxy-PEG4-t-butyl esterMolecular structure of the compound: Hydroxy-PEG4-t-butyl ester322.498%Pricing
BP-20445Hydroxy-PEG5-t-butyl esterMolecular structure of the compound: Hydroxy-PEG5-t-butyl ester366.598%Pricing
BP-20414Hydroxy-PEG6-t-butyl esterMolecular structure of the compound: Hydroxy-PEG6-t-butyl ester410.598%Pricing
BP-23994Hydroxy-PEG7-t-butyl esterMolecular structure of the compound: Hydroxy-PEG7-t-butyl ester454.698%Pricing
BP-21501Hydroxy-PEG8-t-butyl esterMolecular structure of the compound: Hydroxy-PEG8-t-butyl ester498.697%Pricing
BP-23281Hydroxy-PEG9-t-butyl esterMolecular structure of the compound: Hydroxy-PEG9-t-butyl ester542.798%Pricing
BP-22607Hydroxy-PEG10-t-butyl esterMolecular structure of the compound: Hydroxy-PEG10-t-butyl ester586.798%Pricing
BP-24413Hydroxy-PEG11-t-butyl esterMolecular structure of the compound: Hydroxy-PEG11-t-butyl ester630.898%Pricing
BP-21600Hydroxy-PEG12-t-butyl esterMolecular structure of the compound: Hydroxy-PEG12-t-butyl ester674.898%Pricing
BP-21972Hydroxy-PEG13-t-butyl esterMolecular structure of the compound: Hydroxy-PEG13-t-butyl ester718.998%Pricing
BP-21877Hydroxy-PEG16-t-butyl esterMolecular structure of the compound: Hydroxy-PEG16-t-butyl ester85198%Pricing
BP-21922Hydroxy-PEG20-t-butyl esterMolecular structure of the compound: Hydroxy-PEG20-t-butyl ester1027.398%Pricing
BP-21923Hydroxy-PEG24-t-butyl esterMolecular structure of the compound: Hydroxy-PEG24-t-butyl ester1203.597%Pricing
BP-22058Hydroxy-PEG1-CH2CO2tBuMolecular structure of the compound: Hydroxy-PEG1-CH2CO2tBu176.295%Pricing
BP-22082Hydroxy-PEG2-CH2CO2tBuMolecular structure of the compound: Hydroxy-PEG2-CH2CO2tBu220.395%Pricing
BP-22096Hydroxy-PEG3-CH2CO2tBuMolecular structure of the compound: Hydroxy-PEG3-CH2CO2tBu264.395%Pricing
BP-22028Hydroxy-PEG4-CH2CO2tBuMolecular structure of the compound: Hydroxy-PEG4-CH2CO2tBu308.495%Pricing
BP-22097Hydroxy-PEG5-CH2CO2tBuMolecular structure of the compound: Hydroxy-PEG5-CH2CO2tBu352.495%Pricing
BP-22124Hydroxy-PEG6-CH2CO2tBuMolecular structure of the compound: Hydroxy-PEG6-CH2CO2tBu396.595%Pricing
HO-(CH2)3-PEG-t-butyl ester
BP-23636t-Butyl 3-(hydroxypropoxyl)-propanoateMolecular structure of the compound: t-Butyl 3-(hydroxypropoxyl)-propanoate204.398%Pricing
BP-20909PEG3-TosMolecular structure of the compound: PEG3-Tos260.398%Pricing
BP-20690PEG4-TosMolecular structure of the compound: PEG4-Tos304.498%Pricing
BP-20621PEG5-TosMolecular structure of the compound: PEG5-Tos348.498%Pricing
BP-20953PEG6-TosMolecular structure of the compound: PEG6-Tos392.598%Pricing
BP-20464PEG7-TosMolecular structure of the compound: PEG7-Tos436.598%Pricing
BP-23428PEG8-TosMolecular structure of the compound: PEG8-Tos480.698%Pricing
BP-21827PEG9-TosMolecular structure of the compound: PEG9-Tos524.698%Pricing
BP-22064PEG10-TosMolecular structure of the compound: PEG10-Tos568.798%Pricing
BP-22513PEG13-TosMolecular structure of the compound: PEG13-Tos700.898%Pricing
BP-23115PEG21-TosMolecular structure of the compound: PEG21-Tos1053.396%Pricing
Hydroxy-PEG-sulfonic acid
BP-22865Hydroxy-PEG2-sulfonic acidMolecular structure of the compound: Hydroxy-PEG2-sulfonic acid214.298%Pricing
BP-22898Hydroxy-PEG3-sulfonic acidMolecular structure of the compound: Hydroxy-PEG3-sulfonic acid258.398%Pricing
BP-23664Amino-PEG2-alcoholMolecular structure of the compound: Amino-PEG2-alcohol105.198%Pricing
BP-20694Amino-PEG3-alcoholMolecular structure of the compound: Amino-PEG3-alcohol149.298%Pricing
BP-20589Amino-PEG4-alcoholMolecular structure of the compound: Amino-PEG4-alcohol193.298%Pricing
BP-22355Amino-PEG5-alcoholMolecular structure of the compound: Amino-PEG5-alcohol237.398%Pricing
BP-20659Amino-PEG6-alcoholMolecular structure of the compound: Amino-PEG6-alcohol281.498%Pricing
BP-22589Amino-PEG7-alcoholMolecular structure of the compound: Amino-PEG7-alcohol325.498%Pricing
BP-21502Amino-PEG8-alcoholMolecular structure of the compound: Amino-PEG8-alcohol369.598%Pricing
BP-24084Amino-PEG9-alcoholMolecular structure of the compound: Amino-PEG9-alcohol413.598%Pricing
BP-22590Amino-PEG10-alcoholMolecular structure of the compound: Amino-PEG10-alcohol457.698%Pricing
BP-23798Amino-PEG11-alcoholMolecular structure of the compound: Amino-PEG11-alcohol501.698%Pricing
BP-21503Amino-PEG12-alcoholMolecular structure of the compound: Amino-PEG12-alcohol545.798%Pricing
BP-21924Amino-PEG24-alcoholMolecular structure of the compound: Amino-PEG24-alcohol1074.397%Pricing
BP-21925Amino-PEG36-alcoholMolecular structure of the compound: Amino-PEG36-alcohol160397%Pricing
BP-23251Aminooxy-PEG2-alcoholMolecular structure of the compound: Aminooxy-PEG2-alcohol121.198%Pricing
BP-23671Aminooxy-PEG4-alcoholMolecular structure of the compound: Aminooxy-PEG4-alcohol209.298%Pricing
BP-20714Azido-PEG2-alcoholMolecular structure of the compound: Azido-PEG2-alcohol131.198%Pricing
BP-20693Azido-PEG3-alcoholMolecular structure of the compound: Azido-PEG3-alcohol175.298%Pricing
BP-20559Azido-PEG4-alcoholMolecular structure of the compound: Azido-PEG4-alcohol219.298%Pricing
BP-22015Azido-PEG5-alcoholMolecular structure of the compound: Azido-PEG5-alcohol263.398%Pricing
BP-20602Azido-PEG6-alcoholMolecular structure of the compound: Azido-PEG6-alcohol307.398%Pricing
BP-23438Azido-PEG7-alcoholMolecular structure of the compound: Azido-PEG7-alcohol351.498%Pricing
BP-21075Azide-PEG8-alcoholMolecular structure of the compound: Azide-PEG8-alcohol395.598%Pricing
BP-22976Azido-PEG9-alcoholMolecular structure of the compound: Azido-PEG9-alcohol439.598%Pricing
BP-23807Azido-PEG10-alcoholMolecular structure of the compound: Azido-PEG10-alcohol483.698%Pricing
BP-22977Azido-PEG11-alcoholMolecular structure of the compound: Azido-PEG11-alcohol527.698%Pricing
BP-22594Azide-PEG12-alcoholMolecular structure of the compound: Azide-PEG12-alcohol571.798%Pricing
BP-23560Azide-PEG16-alcoholMolecular structure of the compound: Azide-PEG16-alcohol747.998%Pricing
BP-23300Azido-PEG20-alcoholMolecular structure of the compound: Azido-PEG20-alcohol924.190%Pricing
BP-21926Azido-PEG24-alcoholMolecular structure of the compound: Azido-PEG24-alcohol1100.398%Pricing
BP-21927Azido-PEG36-alcoholMolecular structure of the compound: Azido-PEG36-alcohol162997%Pricing
BP-22794Azido-PEG3-(CH2)3OHMolecular structure of the compound: Azido-PEG3-(CH2)3OH233.390%Pricing
BP-23359Azido-PEG4-(CH2)3OHMolecular structure of the compound: Azido-PEG4-(CH2)3OH277.395%Pricing
BP-240253-(Azido-PEG5-amino)propanolMolecular structure of the compound: 3-(Azido-PEG5-amino)propanol364.498%Pricing
BP-20715Bromo-PEG2-alcoholMolecular structure of the compound: Bromo-PEG2-alcohol16998%Pricing
BP-20695Bromo-PEG3-alcoholMolecular structure of the compound: Bromo-PEG3-alcohol213.198%Pricing
BP-20625Bromo-PEG4-alcoholMolecular structure of the compound: Bromo-PEG4-alcohol257.198%Pricing
BP-21691Bromo-PEG5-alcoholMolecular structure of the compound: Bromo-PEG5-alcohol301.298%Pricing
BP-20465Bromo-PEG6-alcoholMolecular structure of the compound: Bromo-PEG6-alcohol345.298%Pricing
BP-21397m-PEG3-alcoholMolecular structure of the compound: m-PEG3-alcohol164.298%Pricing
BP-22067m-PEG4-alcoholMolecular structure of the compound: m-PEG4-alcohol208.398%Pricing
BP-22068m-PEG5-alcoholMolecular structure of the compound: m-PEG5-alcohol252.398%Pricing
BP-22069m-PEG6-alcoholMolecular structure of the compound: m-PEG6-alcohol296.498%Pricing
BP-21574m-PEG7-alcoholMolecular structure of the compound: m-PEG7-alcohol340.498%Pricing
BP-22070m-PEG8-alcoholMolecular structure of the compound: m-PEG8-alcohol384.595%Pricing
BP-22071m-PEG9-alcoholMolecular structure of the compound: m-PEG9-alcohol428.598%Pricing
BP-22072m-PEG10-alcoholMolecular structure of the compound: m-PEG10-alcohol472.698%Pricing
BP-21575m-PEG11-alcoholMolecular structure of the compound: m-PEG11-alcohol516.698%Pricing
BP-22581m-PEG12-alcoholMolecular structure of the compound: m-PEG12-alcohol560.798%Pricing
BP-21576m-PEG15-alcoholMolecular structure of the compound: m-PEG15-alcohol692.898%Pricing
BP-22073m-PEG16-alcoholMolecular structure of the compound: m-PEG16-alcohol736.998%Pricing
BP-21903m-PEG23-alcoholMolecular structure of the compound: m-PEG23-alcohol1045.397%Pricing
BP-22074m-PEG24-alcoholMolecular structure of the compound: m-PEG24-alcohol1089.397%Pricing
BP-21904m-PEG36-alcoholMolecular structure of the compound: m-PEG36-alcohol161897%Pricing
BP-23808m-PEG3-(CH2)3-alcoholMolecular structure of the compound: m-PEG3-(CH2)3-alcohol178.298%Pricing
BP-23742m-PEG4-(CH2)3-alcoholMolecular structure of the compound: m-PEG4-(CH2)3-alcohol222.398%Pricing
BP-22796m-PEG7-(CH2)3-alcoholMolecular structure of the compound: m-PEG7-(CH2)3-alcohol354.498%Pricing
BP-23130C11-PEG4-alcoholMolecular structure of the compound: C11-PEG4-alcohol304.595%Pricing
BP-23169C11-PEG6-alcoholMolecular structure of the compound: C11-PEG6-alcohol392.695%Pricing
BP-23279C11-PEG9-alcoholMolecular structure of the compound: C11-PEG9-alcohol524.795%Pricing
BP-23155C11-PEG13-alcoholMolecular structure of the compound: C11-PEG13-alcohol70195%Pricing
BP-23275N-Boc-PEG2-alcoholMolecular structure of the compound: N-Boc-PEG2-alcohol205.395%Pricing
BP-22242N-Boc-PEG3-alcoholMolecular structure of the compound: N-Boc-PEG3-alcohol249.398%Pricing
BP-21099N-Boc-PEG4-alcoholMolecular structure of the compound: N-Boc-PEG4-alcohol293.498%Pricing
BP-22007N-Boc-PEG5-alcoholMolecular structure of the compound: N-Boc-PEG5-alcohol337.498%Pricing
BP-22598N-Boc-PEG6-alcoholMolecular structure of the compound: N-Boc-PEG6-alcohol381.598%Pricing
BP-23546N-Boc-PEG7-alcoholMolecular structure of the compound: N-Boc-PEG7-alcohol425.598%Pricing
BP-22864N-Boc-PEG8-alcoholMolecular structure of the compound: N-Boc-PEG8-alcohol469.698%Pricing
BP-23547N-Boc-PEG9-alcoholMolecular structure of the compound: N-Boc-PEG9-alcohol513.697%Pricing
BP-25642N-Boc-PEG11-alcoholMolecular structure of the compound: N-Boc-PEG11-alcohol601.798%Pricing
BP-21601N-Boc-PEG12-alcoholMolecular structure of the compound: N-Boc-PEG12-alcohol645.898%Pricing
BP-22979N-Boc-PEG16-alcohol Molecular structure of the compound: N-Boc-PEG16-alcohol  82298%Pricing
BP-22980N-Boc-PEG24-alcohol Molecular structure of the compound: N-Boc-PEG24-alcohol  1174.497%Pricing
BP-22981N-Boc-PEG36-alcohol Molecular structure of the compound: N-Boc-PEG36-alcohol  1703.196%Pricing
BP-21657Propargyl-PEG2-alcoholMolecular structure of the compound: Propargyl-PEG2-alcohol100.198%Pricing
BP-20675Propargyl-PEG3-alcoholMolecular structure of the compound: Propargyl-PEG3-alcohol144.298%Pricing
BP-21724Propargyl-PEG4-alcoholMolecular structure of the compound: Propargyl-PEG4-alcohol188.298%Pricing
BP-20648Propargyl-PEG5-alcoholMolecular structure of the compound: Propargyl-PEG5-alcohol232.398%Pricing
BP-22010Propargyl-PEG6-alcoholMolecular structure of the compound: Propargyl-PEG6-alcohol276.398%Pricing
BP-20719Propargyl-PEG7-alcoholMolecular structure of the compound: Propargyl-PEG7-alcohol320.498%Pricing
BP-22797Propargyl-PEG8-alcoholMolecular structure of the compound: Propargyl-PEG8-alcohol364.498%Pricing
BP-22056Propargyl-PEG9-alcoholMolecular structure of the compound: Propargyl-PEG9-alcohol408.598%Pricing
BP-22812Propargyl-PEG10-alcoholMolecular structure of the compound: Propargyl-PEG10-alcohol452.598%Pricing
BP-22517Propargyl-PEG13-alcoholMolecular structure of the compound: Propargyl-PEG13-alcohol584.798%Pricing
BP-22829Propargyl-PEG14-alcoholMolecular structure of the compound: Propargyl-PEG14-alcohol628.898%Pricing
BP-22856Propargyl-PEG18-alcoholMolecular structure of the compound: Propargyl-PEG18-alcohol80598%Pricing
Mono-protected PEG
BP-21717TBDMS-PEG5Molecular structure of the compound: TBDMS-PEG5308.598%Pricing
BP-23414THP-PEG3Molecular structure of the compound: THP-PEG3190.295%Pricing
BP-22825THP-PEG4Molecular structure of the compound: THP-PEG4234.395%Pricing
BP-21829THP-PEG5Molecular structure of the compound: THP-PEG5278.398%Pricing
BP-21968THP-PEG6Molecular structure of the compound: THP-PEG6322.498%Pricing
BP-21970THP-PEG7Molecular structure of the compound: THP-PEG7366.598%Pricing
BP-23150THP-PEG9Molecular structure of the compound: THP-PEG9454.698%Pricing
BP-23758THP-PEG12Molecular structure of the compound: THP-PEG12586.798%Pricing
BP-23151THP-PEG7-TosMolecular structure of the compound: THP-PEG7-Tos520.698%Pricing
BP-23415Tr-PEG3Molecular structure of the compound: Tr-PEG3348.495%Pricing
BP-20703Tr-PEG4Molecular structure of the compound: Tr-PEG4392.598%Pricing
BP-20702Tr-PEG5Molecular structure of the compound: Tr-PEG5436.698%Pricing
BP-23416Tr-PEG6Molecular structure of the compound: Tr-PEG6480.695%Pricing
BP-20990Tr-PEG7Molecular structure of the compound: Tr-PEG7524.798%Pricing
BP-23135Tr-PEG9Molecular structure of the compound: Tr-PEG9612.898%Pricing
BP-24179(4-methoxyphenyl)diphenylmethylamino-PEG7Molecular structure of the compound: (4-methoxyphenyl)diphenylmethylamino-PEG7597.898%Pricing
Polyethylene Glycol
BP-21036Triethylene glycolMolecular structure of the compound: Triethylene glycol150.299%Pricing
BP-20324Tetraethylene glycolMolecular structure of the compound: Tetraethylene glycol194.296%Pricing
BP-21065Pentaethylene glycolMolecular structure of the compound: Pentaethylene glycol238.398%Pricing
BP-21034Hexaethylene glycolMolecular structure of the compound: Hexaethylene glycol282.398%Pricing
BP-22860Heptaethylene glycol Molecular structure of the compound: Heptaethylene glycol 326.498%Pricing
BP-21369Octanethyl glycolMolecular structure of the compound: Octanethyl glycol370.498%Pricing
BP-22017Nonaethylene glycol Molecular structure of the compound: Nonaethylene glycol 414.598%Pricing
BP-22801PEG11Molecular structure of the compound: PEG11458.698%Pricing
BP-22861PEG12Molecular structure of the compound: PEG12502.6>97%Pricing
BP-21830PEG13Molecular structure of the compound: PEG13546.7>97%Pricing
BP-20952PEG-14Molecular structure of the compound: PEG-14590.798%Pricing
BP-21969PEG15Molecular structure of the compound: PEG15634.8>97%Pricing
BP-23110PEG16Molecular structure of the compound: PEG16678.8>97%Pricing
BP-21971PEG17Molecular structure of the compound: PEG17722.9>97%Pricing
BP-22840PEG18Molecular structure of the compound: PEG18766.9>97%Pricing
BP-23437PEG21Molecular structure of the compound: PEG21899.190%Pricing
BP-23111PEG22Molecular structure of the compound: PEG22943.1>97%Pricing
BP-22804PEG25Molecular structure of the compound: PEG251075.395%Pricing
BP-278583-[2-(3-hydroxypropoxy)ethoxy]propan-1-olMolecular structure of the compound: 3-[2-(3-hydroxypropoxy)ethoxy]propan-1-ol178.2Pricing
BP-27860HO-PPG1-PEG2-PPG1-OHMolecular structure of the compound: HO-PPG1-PEG2-PPG1-OH222.3Pricing
BP-278591,4-Di(3-Hydroxypropoxy)butaneMolecular structure of the compound: 1,4-Di(3-Hydroxypropoxy)butane206.3Pricing
BP-22259t-Boc-Aminooxy-PEG2-alcoholMolecular structure of the compound: t-Boc-Aminooxy-PEG2-alcohol221.398%Pricing
BP-22304t-Boc-Aminooxy-PEG3-alcoholMolecular structure of the compound: t-Boc-Aminooxy-PEG3-alcohol265.398%Pricing
BP-22228t-Boc-Aminooxy-PEG4-alcoholMolecular structure of the compound: t-Boc-Aminooxy-PEG4-alcohol309.498%Pricing
BP-24114t-Boc-Aminooxy-PEG8-alcoholMolecular structure of the compound: t-Boc-Aminooxy-PEG8-alcohol485.695%Pricing
BP-27873t-Boc-Aminooxy-PEG11-alcoholMolecular structure of the compound: t-Boc-Aminooxy-PEG11-alcohol617.798%Pricing
Hydroxy-PEG-methyl ester
BP-23577Hydroxy-PEG1-methyl esterMolecular structure of the compound: Hydroxy-PEG1-methyl ester148.298%Pricing
BP-23678Hydroxy-PEG2-methyl esterMolecular structure of the compound: Hydroxy-PEG2-methyl ester192.298%Pricing
BP-23484Hydroxy-PEG3-methyl esterMolecular structure of the compound: Hydroxy-PEG3-methyl ester236.397%Pricing
BP-24049Hydroxy-PEG4-methyl esterMolecular structure of the compound: Hydroxy-PEG4-methyl ester280.398%Pricing
BP-23624Hydroxy-PEG5-methyl esterMolecular structure of the compound: Hydroxy-PEG5-methyl ester324.498%Pricing
BP-23881Hydroxy-PEG3-acrylateMolecular structure of the compound: Hydroxy-PEG3-acrylate204.298%Pricing
BP-23567Hydroxy-PEG3-2-methylacrylateMolecular structure of the compound: Hydroxy-PEG3-2-methylacrylate218.398%Pricing
BP-23977Hydroxy-PEG4-nitrileMolecular structure of the compound: Hydroxy-PEG4-nitrile247.398%Pricing
BP-229701-isothiocyanato-PEG4-AlcoholMolecular structure of the compound: 1-isothiocyanato-PEG4-Alcohol235.398%Pricing
BP-227931,1,1-Trifluoroethyl-PEG5-alcoholMolecular structure of the compound: 1,1,1-Trifluoroethyl-PEG5-alcohol276.398%Pricing
BP-26349Dimethylanaline-PEG35-alcoholMolecular structure of the compound: Dimethylanaline-PEG35-alcohol1778.2Pricing
Hydroxy Branched PEG
BP-23224NH-bis(PEG1-OH)Molecular structure of the compound: NH-bis(PEG1-OH)193.298%Pricing
BP-23154NH-bis(PEG2-OH)Molecular structure of the compound: NH-bis(PEG2-OH)281.498%Pricing
BP-23293NH-bis(PEG3-OH)Molecular structure of the compound: NH-bis(PEG3-OH)369.598%Pricing
BP-23439NH-bis(PEG4-OH)Molecular structure of the compound: NH-bis(PEG4-OH)457.698%Pricing
BP-22919N-Me-N-bis(PEG3-OH)Molecular structure of the compound: N-Me-N-bis(PEG3-OH)383.598%Pricing
BP-23611N-(PEG1-OH)-N-Boc-PEG2-propargylMolecular structure of the compound: N-(PEG1-OH)-N-Boc-PEG2-propargyl331.498%Pricing
BP-23548Hydroxy-Amino-bis(PEG2-propargyl)Molecular structure of the compound: Hydroxy-Amino-bis(PEG2-propargyl)313.498%Pricing
BP-27343N-(alcohol-PEG2)-N-bis(PEG2-propargyl)Molecular structure of the compound: N-(alcohol-PEG2)-N-bis(PEG2-propargyl)357.5Pricing
BP-23585N-(Propargyl-PEG2)-N-bis(PEG1-alcohol)Molecular structure of the compound: N-(Propargyl-PEG2)-N-bis(PEG1-alcohol)319.498%Pricing
BP-209662-(Azido-PEG2-amido)-1,3-propandiolMolecular structure of the compound: 2-(Azido-PEG2-amido)-1,3-propandiol276.397%Pricing
BP-20914Azido-PEG4-Amido-TrisMolecular structure of the compound: Azido-PEG4-Amido-Tris394.498%Pricing
BP-20698Hydroxy-Amino-bis(PEG1-t-butyl ester)Molecular structure of the compound: Hydroxy-Amino-bis(PEG1-t-butyl ester)405.596%Pricing
BP-23630N-(Hydroxy-PEG3)-N-bis(PEG4-t-butyl ester)Molecular structure of the compound: N-(Hydroxy-PEG3)-N-bis(PEG4-t-butyl ester)80298%Pricing
BP-24525N-(t-butyl-PEG2)-N-bis(PEG3-alcohol)Molecular structure of the compound: N-(t-butyl-PEG2)-N-bis(PEG3-alcohol)613.798%Pricing
BP-22901Tri(t-butoxycarbonylethoxymethyl) ethanolMolecular structure of the compound: Tri(t-butoxycarbonylethoxymethyl) ethanol520.796%Pricing
BP-24231N,N-diethanol amine-PEG4-tert-butyl esterMolecular structure of the compound: N,N-diethanol amine-PEG4-tert-butyl ester409.5Pricing
BP-20962T-Butyl 1,3-dihydroxypropan-2-ylcarbamateMolecular structure of the compound: T-Butyl 1,3-dihydroxypropan-2-ylcarbamate191.298%Pricing
BP-23153tert-butyl bis(2-hydroxyethyl)carbamateMolecular structure of the compound: tert-butyl bis(2-hydroxyethyl)carbamate205.398%Pricing
BP-22402N-Boc-TrisMolecular structure of the compound: N-Boc-Tris221.399%Pricing
BP-23603N-Boc-N-bis(PEG1-OH)Molecular structure of the compound: N-Boc-N-bis(PEG1-OH)293.498%Pricing
BP-23425N-Boc-N-bis(PEG3-OH)Molecular structure of the compound: N-Boc-N-bis(PEG3-OH)469.698%Pricing
BP-23440N-Boc-N-bis(PEG4-OH)Molecular structure of the compound: N-Boc-N-bis(PEG4-OH)557.798%Pricing
BP-23264N-(Boc-PEG3)-N-bis(PEG2-alcohol)Molecular structure of the compound: N-(Boc-PEG3)-N-bis(PEG2-alcohol)556.797%Pricing
BP-23622N-(Hydroxy-PEG3)-N-Boc-PEG4-t-butyl esterMolecular structure of the compound: N-(Hydroxy-PEG3)-N-Boc-PEG4-t-butyl ester597.898%Pricing
BP-23602N-(Biotin)-N-bis(PEG1-alcohol)Molecular structure of the compound: N-(Biotin)-N-bis(PEG1-alcohol)419.598%Pricing
BP-23579N-Benzyl-N-bis(PEG1-OH)Molecular structure of the compound: N-Benzyl-N-bis(PEG1-OH)283.498%Pricing
BP-23418N-Benzyl-N-bis(PEG3-OH)Molecular structure of the compound: N-Benzyl-N-bis(PEG3-OH)459.695%Pricing