PEG Acid

PEG Acid


PEG Acid is a class of PEG linker with one side of PEG containing a carboxylic acid (CO2H) group. PEG Acid will react with an amine-containing moiety in the presence of coupling reagents such as EDC, HATU. PEG Acid can also be converted to a N-hydroxysuccinimide active ester which is widely used in bioconjugation.

Catalog Product Name Structure M.W. Purity Pricing
Amino-PEG-acid
BP-20687Amino-PEG1-acidMolecular structure of the compound: Amino-PEG1-acid133.198%Pricing
BP-20523Amino-PEG2-acidMolecular structure of the compound: Amino-PEG2-acid177.298%Pricing
BP-21588Amino-PEG3-acidMolecular structure of the compound: Amino-PEG3-acid221.398%Pricing
BP-20423Amino-PEG4-acidMolecular structure of the compound: Amino-PEG4-acid265.398%Pricing
BP-21697Amino-PEG5-acidMolecular structure of the compound: Amino-PEG5-acid309.498%Pricing
BP-20424Amino-PEG6-acidMolecular structure of the compound: Amino-PEG6-acid353.498%Pricing
BP-21113Amino-PEG8-acidMolecular structure of the compound: Amino-PEG8-acid441.597%Pricing
BP-21822Amino-PEG9-acidMolecular structure of the compound: Amino-PEG9-acid484.698%Pricing
BP-21818Amino-PEG10-acidMolecular structure of the compound: Amino-PEG10-acid529.698%Pricing
BP-21114Amino-PEG12-acidMolecular structure of the compound: Amino-PEG12-acid617.798%Pricing
BP-21880Amino-PEG16-acidMolecular structure of the compound: Amino-PEG16-acid79498%Pricing
BP-21919Amino-PEG20-acid HCl saltMolecular structure of the compound: Amino-PEG20-acid HCl salt970.298%Pricing
BP-23363Amino-PEG23-acid HCl saltMolecular structure of the compound: Amino-PEG23-acid HCl salt1102.396%Pricing
BP-21910Amino-PEG24-acidMolecular structure of the compound: Amino-PEG24-acid1146.497%Pricing
BP-23358Amino-PEG25-acid HCl saltMolecular structure of the compound: Amino-PEG25-acid HCl salt1190.498%Pricing
BP-23381Amino-PEG32-acidMolecular structure of the compound: Amino-PEG32-acid1498.895%Pricing
BP-22577Amino-PEG36-acidMolecular structure of the compound: Amino-PEG36-acid167597%Pricing
BP-24009Amino-PEG36-CONH-PEG36-acidMolecular structure of the compound: Amino-PEG36-CONH-PEG36-acid333298%Pricing
Amino-PEG-CH2CO2H
BP-22592Amino-PEG2-CH2CO2HMolecular structure of the compound: Amino-PEG2-CH2CO2H163.298%Pricing
BP-22098Amino-PEG4-CH2CO2HMolecular structure of the compound: Amino-PEG4-CH2CO2H251.398%Pricing
Azido-PEG-acid
BP-20902Azido-PEG1-acidMolecular structure of the compound: Azido-PEG1-acid159.197%Pricing
BP-20522Azido-PEG2-acidMolecular structure of the compound: Azido-PEG2-acid203.298%Pricing
BP-21583Azido-PEG3-acidMolecular structure of the compound: Azido-PEG3-acid247.398%Pricing
BP-20517Azido-PEG4-acidMolecular structure of the compound: Azido-PEG4-acid291.398%Pricing
BP-21608Azido-PEG5-acidMolecular structure of the compound: Azido-PEG5-acid335.498%Pricing
BP-20612Azido-PEG6-acidMolecular structure of the compound: Azido-PEG6-acid379.498%Pricing
BP-25636Azido-PEG7-acidMolecular structure of the compound: Azido-PEG7-acid423.598%Pricing
BP-21609Azido-PEG8-acidMolecular structure of the compound: Azido-PEG8-acid467.598%Pricing
BP-21825Azido-PEG9-acidMolecular structure of the compound: Azido-PEG9-acid511.698%Pricing
BP-21820Azido-PEG10-acidMolecular structure of the compound: Azido-PEG10-acid555.698%Pricing
BP-21610Azido-PEG12-acidMolecular structure of the compound: Azido-PEG12-acid643.798%Pricing
BP-22049Azido-PEG24-acidMolecular structure of the compound: Azido-PEG24-acid1172.497%Pricing
BP-23950Azido-PEG36-acidMolecular structure of the compound: Azido-PEG36-acid170198%Pricing
BP-235622-((Azido-PEG8-carbamoyl)methoxy)acetic acidMolecular structure of the compound: 2-((Azido-PEG8-carbamoyl)methoxy)acetic acid554.698%Pricing
Fmoc-N-amido-PEG-acid
BP-21988Fmoc-N-amido-PEG1-acidMolecular structure of the compound: Fmoc-N-amido-PEG1-acid355.498%Pricing
BP-21627Fmoc-N-amido-PEG2-acidMolecular structure of the compound: Fmoc-N-amido-PEG2-acid399.498%Pricing
BP-21628Fmoc-N-amido-PEG3-acidMolecular structure of the compound: Fmoc-N-amido-PEG3-acid443.598%Pricing
BP-20989Fmoc-N-amido-PEG4-acidMolecular structure of the compound: Fmoc-N-amido-PEG4-acid487.698%Pricing
BP-21629Fmoc-N-amido-PEG5-acidMolecular structure of the compound: Fmoc-N-amido-PEG5-acid531.698%Pricing
BP-21630Fmoc-N-amido-PEG6-acidMolecular structure of the compound: Fmoc-N-amido-PEG6-acid575.798%Pricing
BP-22600Fmoc-N-amido-PEG7-acidMolecular structure of the compound: Fmoc-N-amido-PEG7-acid619.798%Pricing
BP-21631Fmoc-N-amido-PEG8-acidMolecular structure of the compound: Fmoc-N-amido-PEG8-acid663.898%Pricing
BP-22601Fmoc-N-amido-PEG9-acidMolecular structure of the compound: Fmoc-N-amido-PEG9-acid707.898%Pricing
BP-22279Fmoc-N-amido-PEG10-acidMolecular structure of the compound: Fmoc-N-amido-PEG10-acid751.998%Pricing
BP-21632Fmoc-N-amido-PEG12-acidMolecular structure of the compound: Fmoc-N-amido-PEG12-acid84098%Pricing
BP-22035Fmoc-N-amido-PEG20-acidMolecular structure of the compound: Fmoc-N-amido-PEG20-acid1192.497%Pricing
BP-22036Fmoc-N-amido-PEG24-acidMolecular structure of the compound: Fmoc-N-amido-PEG24-acid1368.697%Pricing
BP-22037Fmoc-N-amido-PEG36-acidMolecular structure of the compound: Fmoc-N-amido-PEG36-acid1897.398%Pricing
BP-22792Fmoc-NMe-PEG2-acidMolecular structure of the compound: Fmoc-NMe-PEG2-acid413.598%Pricing
BP-23882Fmoc-NMe-PEG4-acidMolecular structure of the compound: Fmoc-NMe-PEG4-acid501.698%Pricing
Fmoc-N-amido-PEG-CH2CO2H
BP-22043Fmoc-NH-PEG1-CH2COOHMolecular structure of the compound: Fmoc-NH-PEG1-CH2COOH341.498%Pricing
BP-22044Fmoc-NH-PEG2-CH2COOHMolecular structure of the compound: Fmoc-NH-PEG2-CH2COOH385.498%Pricing
BP-22045Fmoc-NH-PEG3-CH2COOHMolecular structure of the compound: Fmoc-NH-PEG3-CH2COOH429.598%Pricing
BP-22046Fmoc-NH-PEG4-CH2COOHMolecular structure of the compound: Fmoc-NH-PEG4-CH2COOH473.598%Pricing
BP-22047Fmoc-NH-PEG5-CH2COOHMolecular structure of the compound: Fmoc-NH-PEG5-CH2COOH517.698%Pricing
BP-23534Fmoc-NH-PEG6-CH2COOHMolecular structure of the compound: Fmoc-NH-PEG6-CH2COOH561.695%Pricing
BP-22048Fmoc-NH-PEG8-CH2COOHMolecular structure of the compound: Fmoc-NH-PEG8-CH2COOH649.798%Pricing
BP-23535Fmoc-NH-PEG11-CH2COOHMolecular structure of the compound: Fmoc-NH-PEG11-CH2COOH781.997%Pricing
BP-23536Fmoc-NH-PEG12-CH2COOHMolecular structure of the compound: Fmoc-NH-PEG12-CH2COOH82695%Pricing
t-Boc-N-amido-PEG-acid
BP-20910t-Boc-N-amido-PEG1-acidMolecular structure of the compound: t-Boc-N-amido-PEG1-acid233.398%Pricing
BP-20627t-Boc-N-amido-PEG2-acidMolecular structure of the compound: t-Boc-N-amido-PEG2-acid277.397%Pricing
BP-21656t-Boc-N-amido-PEG3-acidMolecular structure of the compound: t-Boc-N-amido-PEG3-acid321.498%Pricing
BP-21635t-Boc-N-amido-PEG4-acidMolecular structure of the compound: t-Boc-N-amido-PEG4-acid365.498%Pricing
BP-21637t-Boc-N-amido-PEG5-acidMolecular structure of the compound: t-Boc-N-amido-PEG5-acid409.598%Pricing
BP-21636t-Boc-N-amido-PEG6-acidMolecular structure of the compound: t-Boc-N-amido-PEG6-acid453.598%Pricing
BP-22982t-Boc-N-amido-PEG7-acidMolecular structure of the compound: t-Boc-N-amido-PEG7-acid497.698%Pricing
BP-21638t-Boc-N-amido-PEG8-acidMolecular structure of the compound: t-Boc-N-amido-PEG8-acid541.697%Pricing
BP-22040t-Boc-N-amido-PEG10-acidMolecular structure of the compound: t-Boc-N-amido-PEG10-acid629.798%Pricing
BP-21639t-Boc-N-amido-PEG12-acidMolecular structure of the compound: t-Boc-N-amido-PEG12-acid717.998%Pricing
BP-28089t-Boc-N-amido-PEG16-acidMolecular structure of the compound: t-Boc-N-amido-PEG16-acid894.198%Pricing
BP-23530t-Boc-N-amido-PEG20-acidMolecular structure of the compound: t-Boc-N-amido-PEG20-acid1070.398%Pricing
BP-22038t-Boc-N-amido-PEG24-acidMolecular structure of the compound: t-Boc-N-amido-PEG24-acid1246.598%Pricing
BP-28048t-Boc-N-amido-PEG28-acidMolecular structure of the compound: t-Boc-N-amido-PEG28-acid1422.7Pricing
BP-22039t-Boc-N-amido-PEG36-acidMolecular structure of the compound: t-Boc-N-amido-PEG36-acid1775.197%Pricing
t-Boc-N-amido-PEG-CH2CO2H
BP-22041t-Boc-N-amido-PEG1-CH2CO2HMolecular structure of the compound: t-Boc-N-amido-PEG1-CH2CO2H219.298%Pricing
BP-22042t-Boc-N-amido-PEG2-CH2CO2HMolecular structure of the compound: t-Boc-N-amido-PEG2-CH2CO2H263.398%Pricing
BP-22983t-Boc-N-amido-PEG3-CH2CO2HMolecular structure of the compound: t-Boc-N-amido-PEG3-CH2CO2H307.398%Pricing
BP-23531t-Boc-N-amido-PEG4-CH2CO2HMolecular structure of the compound: t-Boc-N-amido-PEG4-CH2CO2H351.498%Pricing
BP-27994t-Boc-N-amido-PEG5-CH2CO2HMolecular structure of the compound: t-Boc-N-amido-PEG5-CH2CO2H395.5Pricing
BP-24355t-Boc-N-amido-PEG6-CH2CO2HMolecular structure of the compound: t-Boc-N-amido-PEG6-CH2CO2H439.598%Pricing
BP-28047t-Boc-N-amido-PEG12-CH2CO2HMolecular structure of the compound: t-Boc-N-amido-PEG12-CH2CO2H703.8Pricing
t-Boc-N-amido-PEG-(CH2)3CO2H
BP-22130t-Boc-N-amido-PEG4-(CH2)3CO2HMolecular structure of the compound: t-Boc-N-amido-PEG4-(CH2)3CO2H379.598%Pricing
Propargyl-PEG-acid
BP-21981Propargyl-PEG1-acidMolecular structure of the compound: Propargyl-PEG1-acid128.198%Pricing
BP-23165Propargyl-PEG2-acidMolecular structure of the compound: Propargyl-PEG2-acid172.298%Pricing
BP-20678Propargyl-PEG3-acidMolecular structure of the compound: Propargyl-PEG3-acid216.298%Pricing
BP-21094Propargyl-PEG4-acidMolecular structure of the compound: Propargyl-PEG4-acid260.398%Pricing
BP-20649Propargyl-PEG5-acidMolecular structure of the compound: Propargyl-PEG5-acid304.398%Pricing
BP-22764Propargyl-PEG6-acidMolecular structure of the compound: Propargyl-PEG6-acid348.498%Pricing
BP-23423Propargyl-PEG7-acidMolecular structure of the compound: Propargyl-PEG7-acid392.598%Pricing
BP-22811Propargyl-PEG8-acidMolecular structure of the compound: Propargyl-PEG8-acid436.598%Pricing
BP-22822Propargyl-PEG10-acidMolecular structure of the compound: Propargyl-PEG10-acid524.698%Pricing
BP-22597Propargyl-PEG13-acidMolecular structure of the compound: Propargyl-PEG13-acid656.898%Pricing
BP-22855Propargyl-PEG14-acidMolecular structure of the compound: Propargyl-PEG14-acid700.898%Pricing
Propargyl-PEG-CH2CO2H
BP-28014Propargyl-PEG3-CH2CO2HMolecular structure of the compound: Propargyl-PEG3-CH2CO2H202.295%Pricing
BP-22737Propargyl-PEG4-CH2CO2HMolecular structure of the compound: Propargyl-PEG4-CH2CO2H246.398%Pricing
BP-23125Propargyl-PEG5-CH2CO2HMolecular structure of the compound: Propargyl-PEG5-CH2CO2H290.398%Pricing
Propargyl-PEG-(CH2)3-acid
BP-23117Propargyl-PEG4-(CH2)3-acidMolecular structure of the compound: Propargyl-PEG4-(CH2)3-acid274.398%Pricing
Acid-PEG-t-butyl ester
BP-23509Acid-PEG1-t-butyl esterMolecular structure of the compound: Acid-PEG1-t-butyl ester218.398%Pricing
BP-23510Acid-PEG2-t-butyl esterMolecular structure of the compound: Acid-PEG2-t-butyl ester262.398%Pricing
BP-22143Acid-PEG3-t-butyl esterMolecular structure of the compound: Acid-PEG3-t-butyl ester306.498%Pricing
BP-22933Acid-PEG4-t-butyl esterMolecular structure of the compound: Acid-PEG4-t-butyl ester350.498%Pricing
BP-20439Acid-PEG5-t-butyl esterMolecular structure of the compound: Acid-PEG5-t-butyl ester394.595%Pricing
BP-23511Acid-PEG6-t-butyl esterMolecular structure of the compound: Acid-PEG6-t-butyl ester438.598%Pricing
BP-26108Acid-PEG8-t-butyl esterMolecular structure of the compound: Acid-PEG8-t-butyl ester526.698%Pricing
BP-25634Acid-PEG10-t-butyl esterMolecular structure of the compound: Acid-PEG10-t-butyl ester614.798%Pricing
BP-24448Acid-PEG12-t-butyl esterMolecular structure of the compound: Acid-PEG12-t-butyl ester702.898%Pricing
BP-24449Acid-PEG14-t-butyl esterMolecular structure of the compound: Acid-PEG14-t-butyl ester790.998%Pricing
BP-26357Acid-PEG25-t-butyl esterMolecular structure of the compound: Acid-PEG25-t-butyl ester1275.598%Pricing
BP-27984t-butyl ester-PEG4-CH2COOHMolecular structure of the compound: t-butyl ester-PEG4-CH2COOH336.4Pricing
BP-24282t-butyl ester-PEG5-CH2COOHMolecular structure of the compound: t-butyl ester-PEG5-CH2COOH380.498%Pricing
BP-28395t-butyl acetate-PEG2-CH2COOHMolecular structure of the compound: t-butyl acetate-PEG2-CH2COOH278.3Pricing
Acid-PEG-mono-methyl ester
BP-22142Acid-PEG3-mono-methyl esterMolecular structure of the compound: Acid-PEG3-mono-methyl ester264.392%Pricing
BP-23330Acid-PEG4-mono-methyl esterMolecular structure of the compound: Acid-PEG4-mono-methyl ester308.398%Pricing
BP-20440Acid-PEG5-mono-methyl esterMolecular structure of the compound: Acid-PEG5-mono-methyl ester352.498%Pricing
BP-22815Acid-PEG6-mono-methyl esterMolecular structure of the compound: Acid-PEG6-mono-methyl ester396.498%Pricing
Methoxycarbonyl-PEG-t-butyl ester
BP-23571Methoxycarbonyl-PEG4-t-butyl esterMolecular structure of the compound: Methoxycarbonyl-PEG4-t-butyl ester364.498%Pricing
Aminoxy-PEG-acid
BP-21809Aminooxy-PEG3-acid HCl saltMolecular structure of the compound: Aminooxy-PEG3-acid HCl salt237.398%Pricing
BP-22136Aminooxy-PEG4-acidMolecular structure of the compound: Aminooxy-PEG4-acid281.398%Pricing
BP-22137Aminooxy-PEG8-acidMolecular structure of the compound: Aminooxy-PEG8-acid457.598%Pricing
Fmoc-aminooxy-PEG-acid
BP-23137Fmoc-aminooxy-PEG4-acidMolecular structure of the compound: Fmoc-aminooxy-PEG4-acid503.698%Pricing
BP-22315Fmoc-aminooxy-PEG12-acidMolecular structure of the compound: Fmoc-aminooxy-PEG12-acid85698%Pricing
t-Boc-Aminooxy-PEG-acid
BP-22966t-Boc-Aminooxy-PEG3-acidMolecular structure of the compound: t-Boc-Aminooxy-PEG3-acid337.498%Pricing
BP-24427t-Boc-Aminooxy-PEG4-acidMolecular structure of the compound: t-Boc-Aminooxy-PEG4-acid381.497%Pricing
BP-27840t-Boc-Aminooxy-PEG10-acidMolecular structure of the compound: t-Boc-Aminooxy-PEG10-acid645.798%Pricing
BP-24092t-Boc-Aminooxy-PEG12-acidMolecular structure of the compound: t-Boc-Aminooxy-PEG12-acid733.998%Pricing
t-Boc-Aminooxy-PEG-CH2CO2H
BP-23625t-Boc-Aminooxy-PEG2-CH2CO2HMolecular structure of the compound: t-Boc-Aminooxy-PEG2-CH2CO2H279.398%Pricing
BP-23353t-Boc-Aminooxy-PEG4-CH2CO2HMolecular structure of the compound: t-Boc-Aminooxy-PEG4-CH2CO2H367.498%Pricing
Carboxy-PEG-sulfonic acid
BP-22881Carboxy-PEG2-sulfonic acidMolecular structure of the compound: Carboxy-PEG2-sulfonic acid242.298%Pricing
BP-22884Carboxy-PEG4-sulfonic acidMolecular structure of the compound: Carboxy-PEG4-sulfonic acid330.498%Pricing
BP-22885Carboxy-PEG5-sulfonic acidMolecular structure of the compound: Carboxy-PEG5-sulfonic acid374.495%Pricing
Cbz-N-amido-PEG-acid
BP-284023-[2-(Cbz-amino)ethoxy]propanoic acidMolecular structure of the compound: 3-[2-(Cbz-amino)ethoxy]propanoic acid267.3Pricing
BP-22313Cbz-N-amido-PEG2-acidMolecular structure of the compound: Cbz-N-amido-PEG2-acid311.398%Pricing
BP-22312Cbz-N-amido-PEG3-acidMolecular structure of the compound: Cbz-N-amido-PEG3-acid355.498%Pricing
BP-21645Cbz-N-amido-PEG4-acidMolecular structure of the compound: Cbz-N-amido-PEG4-acid399.498%Pricing
BP-22314Cbz-N-amido-PEG5-acidMolecular structure of the compound: Cbz-N-amido-PEG5-acid443.598%Pricing
BP-21646Cbz-N-amido-PEG6-acidMolecular structure of the compound: Cbz-N-amido-PEG6-acid487.698%Pricing
BP-21647Cbz-N-amido-PEG8-acidMolecular structure of the compound: Cbz-N-amido-PEG8-acid575.798%Pricing
BP-22863Cbz-N-amido-PEG10-acidMolecular structure of the compound: Cbz-N-amido-PEG10-acid663.898%Pricing
BP-23802Cbz-N-amido-PEG20-acidMolecular structure of the compound: Cbz-N-amido-PEG20-acid1104.397%Pricing
BP-28387CbzNH-PEG4-CH2COOHMolecular structure of the compound: CbzNH-PEG4-CH2COOH385.4Pricing
Biotin-PEG-acid
BP-20613Biotin-PEG2-acidMolecular structure of the compound: Biotin-PEG2-acid403.598%Pricing
BP-20699Biotin-PEG3-acidMolecular structure of the compound: Biotin-PEG3-acid447.698%Pricing
BP-20607Biotin-PEG4-acidMolecular structure of the compound: Biotin-PEG4-acid491.698%Pricing
BP-20604Biotin-PEG6-acidMolecular structure of the compound: Biotin-PEG6-acid579.798%Pricing
BP-21835Biotin-PEG8-acidMolecular structure of the compound: Biotin-PEG8-acid667.898%Pricing
BP-21620Biotin-PEG12-acidMolecular structure of the compound: Biotin-PEG12-acid84498%Pricing
BP-21958Biotin-PEG24-acidMolecular structure of the compound: Biotin-PEG24-acid1372.797%Pricing
BP-24320Biotin-PEG36-acidMolecular structure of the compound: Biotin-PEG36-acid1901.398%Pricing
DNP-PEG-acid
BP-20563DNP-PEG2-acidMolecular structure of the compound: DNP-PEG2-acid343.398%Pricing
BP-20561DNP-PEG4-acidMolecular structure of the compound: DNP-PEG4-acid431.498%Pricing
BP-20562DNP-PEG6-acidMolecular structure of the compound: DNP-PEG6-acid519.598%Pricing
BP-22398DNP-PEG12-acidMolecular structure of the compound: DNP-PEG12-acid783.898%Pricing
m-PEG-acid
BP-23501m-PEG1-acidMolecular structure of the compound: m-PEG1-acid104.197%Pricing
BP-21571m-PEG2-acidMolecular structure of the compound: m-PEG2-acid148.298%Pricing
BP-20981m-PEG3-acidMolecular structure of the compound: m-PEG3-acid192.298%Pricing
BP-20979m-PEG4-acidMolecular structure of the compound: m-PEG4-acid236.398%Pricing
BP-20455m-PEG5-acidMolecular structure of the compound: m-PEG5-acid280.398%Pricing
BP-20511m-PEG6-acidMolecular structure of the compound: m-PEG6-acid324.498%Pricing
BP-20457m-PEG7-acidMolecular structure of the compound: m-PEG7-acid368.498%Pricing
BP-21106m-PEG8-acidMolecular structure of the compound: m-PEG8-acid412.596%Pricing
BP-22091m-PEG9-acidMolecular structure of the compound: m-PEG9-acid456.598%Pricing
BP-22092m-PEG10-acidMolecular structure of the compound: m-PEG10-acid500.698%Pricing
BP-22093m-PEG11-acidMolecular structure of the compound: m-PEG11-acid544.698%Pricing
BP-21105m-PEG12-acidMolecular structure of the compound: m-PEG12-acid588.798%Pricing
BP-22578m-PEG13-acidMolecular structure of the compound: m-PEG13-acid632.798%Pricing
BP-25515m-PEG16-acidMolecular structure of the compound: m-PEG16-acid764.998%Pricing
BP-22094m-PEG17-acidMolecular structure of the compound: m-PEG17-acid80998%Pricing
BP-21900m-PEG24-acidMolecular structure of the compound: m-PEG24-acid1117.395%Pricing
BP-22579m-PEG25-acidMolecular structure of the compound: m-PEG25-acid1161.497%Pricing
BP-21901m-PEG37-acidMolecular structure of the compound: m-PEG37-acid169097%Pricing
BP-242243-(m-PEG8-ethoxycarbonyl)propanoic acidMolecular structure of the compound: 3-(m-PEG8-ethoxycarbonyl)propanoic acid484.5Pricing
BP-242263-(m-PEG12-ethoxycarbonyl)propanoic acidMolecular structure of the compound: 3-(m-PEG12-ethoxycarbonyl)propanoic acid660.8Pricing
BP-23227m-PEG3-acid chlorideMolecular structure of the compound: m-PEG3-acid chloride210.798%Pricing
m-PEG-CH2COOH
BP-23432m-PEG4-CH2COOHMolecular structure of the compound: m-PEG4-CH2COOH222.298%Pricing
BP-23433m-PEG5-CH2COOHMolecular structure of the compound: m-PEG5-CH2COOH266.398%Pricing
BP-23434m-PEG6-CH2COOHMolecular structure of the compound: m-PEG6-CH2COOH310.398%Pricing
BP-23435m-PEG7-CH2COOHMolecular structure of the compound: m-PEG7-CH2COOH354.498%Pricing
BP-23436m-PEG9-CH2COOHMolecular structure of the compound: m-PEG9-CH2COOH442.598%Pricing
BP-24463m-PEG11-CH2CO2HMolecular structure of the compound: m-PEG11-CH2CO2H530.698%Pricing
m-PEG-(CH2)3-acid
BP-22992m-PEG4-(CH2)3-acidMolecular structure of the compound: m-PEG4-(CH2)3-acid250.398%Pricing
m-PEG-CH2CH2NHCH2CH2COOH
BP-24187m-PEG12-CH2CH2NHCH2CH2COOHMolecular structure of the compound: m-PEG12-CH2CH2NHCH2CH2COOH631.897%Pricing
Hydroxy-PEG-acid
BP-23136Hydroxy-PEG2-acid sodium saltMolecular structure of the compound: Hydroxy-PEG2-acid sodium salt200.295%Pricing
BP-25119Hydroxy-PEG4-acid sodium saltMolecular structure of the compound: Hydroxy-PEG4-acid sodium salt288.395%Pricing
BP-25145Hydroxy-PEG8-acid sodium saltMolecular structure of the compound: Hydroxy-PEG8-acid sodium salt464.596%Pricing
BP-24490Hydroxy-PEG10-acid sodium saltMolecular structure of the compound: Hydroxy-PEG10-acid sodium salt552.695%Pricing
Hydroxy-PEG-CH2CO2H
BP-22783Hydroxy-PEG2-CH2CO2H sodium saltMolecular structure of the compound: Hydroxy-PEG2-CH2CO2H sodium salt164.298%Pricing
BP-23621Hydroxy-PEG4-CH2CO2H sodium saltMolecular structure of the compound: Hydroxy-PEG4-CH2CO2H sodium salt252.397%Pricing
N-methyl-N-(t-Boc)-PEG-acid
BP-22766N-methyl-N-(t-Boc)-PEG4-acidMolecular structure of the compound: N-methyl-N-(t-Boc)-PEG4-acid379.598%Pricing
Acid-PEG-PFP ester
BP-22964Acid-PEG3-PFP esterMolecular structure of the compound: Acid-PEG3-PFP ester416.397%Pricing
Acid-PEG-TEMPO
BP-23157Acid-PEG5-TEMPOMolecular structure of the compound: Acid-PEG5-TEMPO491.695%Pricing
Acid Branched PEG
BP-235992-Amino-1,3-bis(carboxylethoxy)propane HCl saltMolecular structure of the compound: 2-Amino-1,3-bis(carboxylethoxy)propane HCl salt235.298%Pricing
BP-23263N-(Amino-PEG3)-N-bis(PEG3-acid) HCl saltMolecular structure of the compound: N-(Amino-PEG3)-N-bis(PEG3-acid) HCl salt600.797%Pricing
BP-23480N-(Amino-PEG5)-N-bis(PEG4-acid)Molecular structure of the compound: N-(Amino-PEG5)-N-bis(PEG4-acid)776.998%Pricing
BP-23868N-(acid-PEG3)-N-bis(PEG3-amine)Molecular structure of the compound: N-(acid-PEG3)-N-bis(PEG3-amine)571.798%Pricing
BP-23953N-(Azido-PEG3)-N-(PEG2-amine)-PEG3-acidMolecular structure of the compound: N-(Azido-PEG3)-N-(PEG2-amine)-PEG3-acid581.798%Pricing
BP-23952Amino-Tri-(carboxyethoxymethyl)-methaneMolecular structure of the compound: Amino-Tri-(carboxyethoxymethyl)-methane337.398%Pricing
BP-25617Amine-PEG4-Amido-tri-(carboxyethoxymethyl)-methaneMolecular structure of the compound: Amine-PEG4-Amido-tri-(carboxyethoxymethyl)-methane584.698%Pricing
BP-28184NH-bis(PEG1-acid)Molecular structure of the compound: NH-bis(PEG1-acid)249.395%Pricing
BP-23226NH-bis(PEG2-acid) HCl saltMolecular structure of the compound: NH-bis(PEG2-acid) HCl salt337.498%Pricing
BP-23235NH-bis(PEG3-acid) HCl saltMolecular structure of the compound: NH-bis(PEG3-acid) HCl salt425.598%Pricing
BP-23254NH-bis(PEG4-acid) HCl saltMolecular structure of the compound: NH-bis(PEG4-acid) HCl salt513.698%Pricing
BP-27950N-(Azido-PEG1)-N-bis(PEG2-acid), HCl saltMolecular structure of the compound: N-(Azido-PEG1)-N-bis(PEG2-acid), HCl salt48798%Pricing
BP-27949N-(Azido-PEG1)-N-bis(PEG3-acid), HCl saltMolecular structure of the compound: N-(Azido-PEG1)-N-bis(PEG3-acid), HCl salt575.198%Pricing
BP-25507N-(Azido-PEG2)-N-bis(PEG4-Acid)Molecular structure of the compound: N-(Azido-PEG2)-N-bis(PEG4-Acid)670.898%Pricing
BP-23260N-(Azido-PEG3)-N-bis(PEG3-acid) HCl saltMolecular structure of the compound: N-(Azido-PEG3)-N-bis(PEG3-acid) HCl salt626.797%Pricing
BP-23573N-(Azido-PEG3)-N-bis(PEG4-acid)Molecular structure of the compound: N-(Azido-PEG3)-N-bis(PEG4-acid)714.898%Pricing
BP-23471N-(Azido-PEG4)-N-bis(PEG4-acid) HCl saltMolecular structure of the compound: N-(Azido-PEG4)-N-bis(PEG4-acid) HCl salt758.998%Pricing
BP-235262-(Azido-PEG3-amido)-1,3-bis(carboxylethoxy)propaneMolecular structure of the compound: 2-(Azido-PEG3-amido)-1,3-bis(carboxylethoxy)propane464.598%Pricing
BP-25111N-(Azido-PEG4)-N-bis(PEG4-acid)Molecular structure of the compound: N-(Azido-PEG4)-N-bis(PEG4-acid)786.998%Pricing
BP-23825N-(acid-PEG3)-N-bis(PEG3-azide)Molecular structure of the compound: N-(acid-PEG3)-N-bis(PEG3-azide)623.798%Pricing
BP-24493N-(acid-PEG24)-N-bis(PEG3-azide)Molecular structure of the compound: N-(acid-PEG24)-N-bis(PEG3-azide)1548.898%Pricing
BP-25635N-(acid-PEG10)-N-bis(PEG10-azide)Molecular structure of the compound: N-(acid-PEG10)-N-bis(PEG10-azide)1548.896%Pricing
BP-25694N-bis(Azide-PEG23)-N-(PEG24-Acid)Molecular structure of the compound: N-bis(Azide-PEG23)-N-(PEG24-Acid)331198%Pricing
BP-24331N-(Acid-PEG2)-N-bis(PEG3-azide)Molecular structure of the compound: N-(Acid-PEG2)-N-bis(PEG3-azide)607.798%Pricing
BP-23953N-(Azido-PEG3)-N-(PEG2-amine)-PEG3-acidMolecular structure of the compound: N-(Azido-PEG3)-N-(PEG2-amine)-PEG3-acid581.798%Pricing
BP-25610Azidobutanamide-tri-(carboxyethoxymethyl)-methaneMolecular structure of the compound: Azidobutanamide-tri-(carboxyethoxymethyl)-methane448.498%Pricing
BP-20919Azido-PEG4-Amido-tri-(carboxyethoxymethyl)-methaneMolecular structure of the compound: Azido-PEG4-Amido-tri-(carboxyethoxymethyl)-methane610.696%Pricing
BP-25517Acid-PEG5-Amide-Tri(3-methoxypropanamide-PEG4-Azide) MethaneMolecular structure of the compound: Acid-PEG5-Amide-Tri(3-methoxypropanamide-PEG4-Azide) Methane1390.698%Pricing
BP-25668(Acid-PEG10)-Tri-(Azide-PEG10-ethoxymethyl)-methaneMolecular structure of the compound: (Acid-PEG10)-Tri-(Azide-PEG10-ethoxymethyl)-methane2403.898%Pricing
BP-26521Acid-PEG25-Amide-Tri(3-methoxypropanamide-PEG10-Azide) MethaneMolecular structure of the compound: Acid-PEG25-Amide-Tri(3-methoxypropanamide-PEG10-Azide) Methane3064.698%Pricing
BP-27704Acid-PEG25-Amide-Tri(3-methoxypropanamide-PEG23-Azide) MethaneMolecular structure of the compound: Acid-PEG25-Amide-Tri(3-methoxypropanamide-PEG23-Azide) Methane4782.795%Pricing
BP-23504N-(Azido-PEG2)-N-Boc-PEG3-acidMolecular structure of the compound: N-(Azido-PEG2)-N-Boc-PEG3-acid478.598%Pricing
BP-23505N-(Azido-PEG2)-N-Boc-PEG4-acidMolecular structure of the compound: N-(Azido-PEG2)-N-Boc-PEG4-acid522.698%Pricing
BP-23569N-(Azido-PEG3)-N-Boc-PEG3-acidMolecular structure of the compound: N-(Azido-PEG3)-N-Boc-PEG3-acid522.695%Pricing
BP-23578N-(Azido-PEG3)-N-Boc-PEG4-acidMolecular structure of the compound: N-(Azido-PEG3)-N-Boc-PEG4-acid566.798%Pricing
BP-235082-(Biotin-amido)-1,3-bis(carboxylethoxy)propaneMolecular structure of the compound: 2-(Biotin-amido)-1,3-bis(carboxylethoxy)propane461.598%Pricing
BP-24425N-(acid-PEG3)-N-bis(PEG3-biotin)Molecular structure of the compound: N-(acid-PEG3)-N-bis(PEG3-biotin)1024.398%Pricing
BP-23278N-Biotin-N-bis(PEG4-acid)Molecular structure of the compound: N-Biotin-N-bis(PEG4-acid)739.998%Pricing
BP-23554N-(Biotin-PEG4)-N-bis(PEG4-acid) HCl saltMolecular structure of the compound: N-(Biotin-PEG4)-N-bis(PEG4-acid) HCl salt959.298%Pricing
BP-23650N-(Amino-PEG4)-N-Biotin-PEG4-acidMolecular structure of the compound: N-(Amino-PEG4)-N-Biotin-PEG4-acid710.998%Pricing
BP-23574N-(Azido-PEG2)-N-Biotin-PEG3-acidMolecular structure of the compound: N-(Azido-PEG2)-N-Biotin-PEG3-acid604.798%Pricing
BP-215364-(N-Boc-amino)-1,6-heptanedioic acidMolecular structure of the compound: 4-(N-Boc-amino)-1,6-heptanedioic acid275.397%Pricing
BP-209632-t-Butoxycarbonylamino-1,3-bis(carboxyethoxy)propaneMolecular structure of the compound: 2-t-Butoxycarbonylamino-1,3-bis(carboxyethoxy)propane335.496%Pricing
BP-25618Boc-NH-Tri-(carbonylethoxymethyl)-methaneMolecular structure of the compound: Boc-NH-Tri-(carbonylethoxymethyl)-methane437.498%Pricing
BP-25609Cbz-N-amido-tri-(carboxyethoxymethyl)-methaneMolecular structure of the compound: Cbz-N-amido-tri-(carboxyethoxymethyl)-methane471.597%Pricing
BP-23265N-(Boc-PEG3)-N-bis(PEG3-acid)Molecular structure of the compound: N-(Boc-PEG3)-N-bis(PEG3-acid)700.897%Pricing
BP-23481N-(Boc-PEG5)-N-bis(PEG4-acid)Molecular structure of the compound: N-(Boc-PEG5)-N-bis(PEG4-acid)87798%Pricing
BP-23410N-Boc-N-bis(PEG2-acid)Molecular structure of the compound: N-Boc-N-bis(PEG2-acid)437.597%Pricing
BP-23247N-Boc-N-bis(PEG3-acid)Molecular structure of the compound: N-Boc-N-bis(PEG3-acid)525.698%Pricing
BP-23482N-Boc-N-bis(PEG4-acid)Molecular structure of the compound: N-Boc-N-bis(PEG4-acid)613.798%Pricing
BP-23506N-(Propargyl-PEG4)-N-bis(PEG4-acid) HCl saltMolecular structure of the compound: N-(Propargyl-PEG4)-N-bis(PEG4-acid) HCl salt727.998%Pricing
BP-28187N-(Propargyl-PEG4-carbonyl)-N-bis(PEG1-acid)Molecular structure of the compound: N-(Propargyl-PEG4-carbonyl)-N-bis(PEG1-acid)491.5Pricing
BP-23550N-(Acid-PEG2)-N-bis(PEG2-propargyl)Molecular structure of the compound: N-(Acid-PEG2)-N-bis(PEG2-propargyl)429.598%Pricing
BP-20706Tri(carboxyethyloxyethyl)amine HCl saltMolecular structure of the compound: Tri(carboxyethyloxyethyl)amine HCl salt365.498%Pricing
BP-209301,3-bis(carboxyethoxy)-2,2-bis(carboxyethoxy)propaneMolecular structure of the compound: 1,3-bis(carboxyethoxy)-2,2-bis(carboxyethoxy)propane424.492%Pricing
BP-23738N-Mal-N-bis(PEG2-acid)Molecular structure of the compound: N-Mal-N-bis(PEG2-acid)488.598%Pricing
BP-23654N-Mal-N-bis(PEG4-acid)Molecular structure of the compound: N-Mal-N-bis(PEG4-acid)664.798%Pricing
BP-23457N-Benzyl-N-bis(PEG3-acid)Molecular structure of the compound: N-Benzyl-N-bis(PEG3-acid)515.698%Pricing
BP-23754N-DBCO-N-bis(PEG2-acid)Molecular structure of the compound: N-DBCO-N-bis(PEG2-acid)624.798%Pricing
BP-25448DBCO-N-bis(PEG4-acid)Molecular structure of the compound: DBCO-N-bis(PEG4-acid)800.998%Pricing
BP-28219N-DBCO-N-bis(PEG2-amide-PEG4-Acid)Molecular structure of the compound: N-DBCO-N-bis(PEG2-amide-PEG4-Acid)1119.395%Pricing
BP-23299Methyltetrazine-amido-N-bis(PEG4-acid)Molecular structure of the compound: Methyltetrazine-amido-N-bis(PEG4-acid)725.898%Pricing
BP-25718Methyltetrazine-amido-bis-(carboxyethoxymethyl)-methaneMolecular structure of the compound: Methyltetrazine-amido-bis-(carboxyethoxymethyl)-methane447.5Pricing
BP-25697Methyltetrazine-amido-Tri-(acid-PEG1-ethoxymethyl)-methaneMolecular structure of the compound: Methyltetrazine-amido-Tri-(acid-PEG1-ethoxymethyl)-methane549.598%Pricing
BP-25705(Methyltetrazine-PEG10)-Tri-(Azide-PEG10-ethoxymethyl)-methaneMolecular structure of the compound: (Methyltetrazine-PEG10)-Tri-(Azide-PEG10-ethoxymethyl)-methane2501.9Pricing
BP-25624N-(TCO)-N-bis(PEG4-acid)Molecular structure of the compound: N-(TCO)-N-bis(PEG4-acid)665.898%Pricing
BP-23521N-(Azido-PEG2)-N-Fluorescein-PEG3-acidMolecular structure of the compound: N-(Azido-PEG2)-N-Fluorescein-PEG3-acid767.898%Pricing
BP-23522N-(Azido-PEG2)-N-Fluorescein-PEG4-acidMolecular structure of the compound: N-(Azido-PEG2)-N-Fluorescein-PEG4-acid811.998%Pricing
BP-23566N-(Azido-PEG3)-N-Fluorescein-PEG3-acidMolecular structure of the compound: N-(Azido-PEG3)-N-Fluorescein-PEG3-acid811.998%Pricing
Other PEG acid
BP-25693N-Boc-N'-(PEG1-t-butyl ester)-L-Lysine-OHMolecular structure of the compound: N-Boc-N-(PEG1-t-butyl ester)-L-Lysine-OH446.598%Pricing
BP-26341Dimethylanaline-PEG4-acidMolecular structure of the compound: Dimethylanaline-PEG4-acid440.598%Pricing