BroadPharm provides homobifunctional or heterobifunctional branched PEGs (PEG-X-PEG) linked with functionalized amine group (N) or thiol group (S).

Catalog Product Name Structure M.W. Purity Pricing
BP-23224NH-bis(PEG1-OH)Molecular structure of the compound: NH-bis(PEG1-OH)193.298%Pricing
BP-23154NH-bis(PEG2-OH)Molecular structure of the compound: NH-bis(PEG2-OH)281.498%Pricing
BP-23293NH-bis(PEG3-OH)Molecular structure of the compound: NH-bis(PEG3-OH)369.598%Pricing
BP-23439NH-bis(PEG4-OH)Molecular structure of the compound: NH-bis(PEG4-OH)457.698%Pricing
BP-28184NH-bis(PEG1-acid)Molecular structure of the compound: NH-bis(PEG1-acid)249.3Pricing
BP-23226NH-bis(PEG2-acid) HCl saltMolecular structure of the compound: NH-bis(PEG2-acid) HCl salt337.498%Pricing
BP-23235NH-bis(PEG3-acid) HCl saltMolecular structure of the compound: NH-bis(PEG3-acid) HCl salt425.598%Pricing
BP-23254NH-bis(PEG4-acid) HCl saltMolecular structure of the compound: NH-bis(PEG4-acid) HCl salt513.698%Pricing
BP-23618NH-bis(PEG1-azide)Molecular structure of the compound: NH-bis(PEG1-azide)243.398%Pricing
BP-23312NH-bis(PEG3-azide)Molecular structure of the compound: NH-bis(PEG3-azide)419.598%Pricing
BP-23957N-(Azido-PEG3)-NH-PEG3-acid HCl saltMolecular structure of the compound: N-(Azido-PEG3)-NH-PEG3-acid HCl salt422.598%Pricing
BP-25651N-(Azido-PEG10)-N-PEG10-acidMolecular structure of the compound: N-(Azido-PEG10)-N-PEG10-acid1039.298%Pricing
BP-25504N-(Azido-PEG2)-N-PEG4-t-butyl esterMolecular structure of the compound: N-(Azido-PEG2)-N-PEG4-t-butyl ester478.698%Pricing
BP-24492N-(Azido-PEG3)-NH-PEG3-t-butyl esterMolecular structure of the compound: N-(Azido-PEG3)-NH-PEG3-t-butyl ester478.698%Pricing
BP-25666N-(Azido-PEG3)-PEG4-t-butyl esterMolecular structure of the compound: N-(Azido-PEG3)-PEG4-t-butyl ester522.698%Pricing
BP-25645N-(Azido-PEG10)-N-PEG10-t-butyl esterMolecular structure of the compound: N-(Azido-PEG10)-N-PEG10-t-butyl ester1095.397%Pricing
BP-24496N-(Methylamino-PEG3)-NH-PEG3-acid Molecular structure of the compound: N-(Methylamino-PEG3)-NH-PEG3-acid 410.598%Pricing
BP-23613NH-bis(PEG2-propargyl)Molecular structure of the compound: NH-bis(PEG2-propargyl)269.398%Pricing
BP-25485N-(Propargyl-PEG2)-PEG3-t-butyl esterMolecular structure of the compound: N-(Propargyl-PEG2)-PEG3-t-butyl ester403.598%Pricing
BP-23773NH-bis(PEG2-Boc)Molecular structure of the compound: NH-bis(PEG2-Boc)479.698%Pricing
BP-23225NH-bis(PEG3-Boc)Molecular structure of the compound: NH-bis(PEG3-Boc)567.798%Pricing
BP-23782NH-bis(PEG4-Boc)Molecular structure of the compound: NH-bis(PEG4-Boc)655.898%Pricing
BP-22160NH-bis(m-PEG4)Molecular structure of the compound: NH-bis(m-PEG4)397.598%Pricing
BP-22161NH-bis(m-PEG8)Molecular structure of the compound: NH-bis(m-PEG8)749.998%Pricing
BP-23233NH-bis(PEG2-t-butyl ester)Molecular structure of the compound: NH-bis(PEG2-t-butyl ester)449.698%Pricing
BP-23234NH-bis(PEG3-t-butyl ester)Molecular structure of the compound: NH-bis(PEG3-t-butyl ester)537.798%Pricing
BP-23253NH-bis(PEG4-t-butyl ester)Molecular structure of the compound: NH-bis(PEG4-t-butyl ester)625.898%Pricing
BP-23631N-(Boc-PEG4)-NH-PEG4-t-butyl esterMolecular structure of the compound: N-(Boc-PEG4)-NH-PEG4-t-butyl ester640.898%Pricing
BP-23603N-Boc-N-bis(PEG1-OH)Molecular structure of the compound: N-Boc-N-bis(PEG1-OH)293.498%Pricing
BP-23425N-Boc-N-bis(PEG3-OH)Molecular structure of the compound: N-Boc-N-bis(PEG3-OH)469.698%Pricing
BP-23440N-Boc-N-bis(PEG4-OH)Molecular structure of the compound: N-Boc-N-bis(PEG4-OH)557.798%Pricing
BP-23410N-Boc-N-bis(PEG2-acid)Molecular structure of the compound: N-Boc-N-bis(PEG2-acid)437.597%Pricing
BP-23247N-Boc-N-bis(PEG3-acid)Molecular structure of the compound: N-Boc-N-bis(PEG3-acid)525.698%Pricing
BP-23482N-Boc-N-bis(PEG4-acid)Molecular structure of the compound: N-Boc-N-bis(PEG4-acid)613.798%Pricing
BP-23612N-Boc-N-bis(PEG1-azide)Molecular structure of the compound: N-Boc-N-bis(PEG1-azide)343.498%Pricing
BP-23311N-Boc-N-bis(PEG3-azide)Molecular structure of the compound: N-Boc-N-bis(PEG3-azide)519.698%Pricing
BP-23195N-Boc-N-bis(PEG4-azide)Molecular structure of the compound: N-Boc-N-bis(PEG4-azide)607.798%Pricing
BP-23610N-Boc-N-bis(PEG2-propargyl)Molecular structure of the compound: N-Boc-N-bis(PEG2-propargyl)369.598%Pricing
BP-23255N-Boc-N-bis(PEG3-NHS ester)Molecular structure of the compound: N-Boc-N-bis(PEG3-NHS ester)719.797%Pricing
BP-23498N-Boc-N-bis(PEG4-NHS ester)Molecular structure of the compound: N-Boc-N-bis(PEG4-NHS ester)807.997%Pricing
BP-23504N-(Azido-PEG2)-N-Boc-PEG3-acidMolecular structure of the compound: N-(Azido-PEG2)-N-Boc-PEG3-acid478.598%Pricing
BP-23505N-(Azido-PEG2)-N-Boc-PEG4-acidMolecular structure of the compound: N-(Azido-PEG2)-N-Boc-PEG4-acid522.698%Pricing
BP-23569N-(Azido-PEG3)-N-Boc-PEG3-acidMolecular structure of the compound: N-(Azido-PEG3)-N-Boc-PEG3-acid522.695%Pricing
BP-23578N-(Azido-PEG3)-N-Boc-PEG4-acidMolecular structure of the compound: N-(Azido-PEG3)-N-Boc-PEG4-acid566.798%Pricing
BP-23518N-(Azido-PEG2)-N-Boc-PEG3-NHS esterMolecular structure of the compound: N-(Azido-PEG2)-N-Boc-PEG3-NHS ester575.698%Pricing
BP-23523N-(Azido-PEG2)-N-Boc-PEG4-NHS esterMolecular structure of the compound: N-(Azido-PEG2)-N-Boc-PEG4-NHS ester619.798%Pricing
BP-23565N-(Azido-PEG3)-N-Boc-PEG3-NHS esterMolecular structure of the compound: N-(Azido-PEG3)-N-Boc-PEG3-NHS ester619.798%Pricing
BP-23586N-(Azido-PEG3)-N-Boc-PEG4-NHS esterMolecular structure of the compound: N-(Azido-PEG3)-N-Boc-PEG4-NHS ester663.796%Pricing
BP-23483N-(Azido-PEG2)-N-Boc-PEG3-t-butyl esterMolecular structure of the compound: N-(Azido-PEG2)-N-Boc-PEG3-t-butyl ester534.798%Pricing
BP-23507N-(Azido-PEG2)-N-Boc-PEG4-t-butyl esterMolecular structure of the compound: N-(Azido-PEG2)-N-Boc-PEG4-t-butyl ester578.798%Pricing
BP-23597N-(Azido-PEG3)-N-Boc-PEG3-t-butyl esterMolecular structure of the compound: N-(Azido-PEG3)-N-Boc-PEG3-t-butyl ester578.798%Pricing
BP-23576N-(Azido-PEG3)-N-Boc-PEG4-t-butyl esterMolecular structure of the compound: N-(Azido-PEG3)-N-Boc-PEG4-t-butyl ester622.898%Pricing
BP-23478N-(Azido-PEG4)-N-Boc-PEG3-t-butyl esterMolecular structure of the compound: N-(Azido-PEG4)-N-Boc-PEG3-t-butyl ester622.898%Pricing
BP-23634N-(Azido-PEG4)-N-Boc-PEG4-t-butyl esterMolecular structure of the compound: N-(Azido-PEG4)-N-Boc-PEG4-t-butyl ester666.898%Pricing
BP-23622N-(Hydroxy-PEG3)-N-Boc-PEG4-t-butyl esterMolecular structure of the compound: N-(Hydroxy-PEG3)-N-Boc-PEG4-t-butyl ester597.898%Pricing
BP-23611N-(PEG1-OH)-N-Boc-PEG2-propargylMolecular structure of the compound: N-(PEG1-OH)-N-Boc-PEG2-propargyl331.498%Pricing
BP-23468N-(Propargyl-PEG2)-N-Boc-PEG3-t-butyl esterMolecular structure of the compound: N-(Propargyl-PEG2)-N-Boc-PEG3-t-butyl ester503.698%Pricing
BP-23784N-Mal-N-bis(PEG2-amine) TFA saltMolecular structure of the compound: N-Mal-N-bis(PEG2-amine) TFA salt430.598%Pricing
BP-23738N-Mal-N-bis(PEG2-acid)Molecular structure of the compound: N-Mal-N-bis(PEG2-acid)488.598%Pricing
BP-23654N-Mal-N-bis(PEG4-acid)Molecular structure of the compound: N-Mal-N-bis(PEG4-acid)664.798%Pricing
BP-23777N-Mal-N-bis(PEG2-NHS ester)Molecular structure of the compound: N-Mal-N-bis(PEG2-NHS ester)682.698%Pricing
BP-23736N-Mal-N-bis(PEG4-NHS ester)Molecular structure of the compound: N-Mal-N-bis(PEG4-NHS ester)858.998%Pricing
BP-23786N-Mal-N-bis(PEG4-amine) TFA saltMolecular structure of the compound: N-Mal-N-bis(PEG4-amine) TFA salt606.798%Pricing
BP-23781N-Mal-N-bis(PEG2-NH-Boc)Molecular structure of the compound: N-Mal-N-bis(PEG2-NH-Boc)630.798%Pricing
BP-23783N-Mal-N-bis(PEG4-NH-Boc)Molecular structure of the compound: N-Mal-N-bis(PEG4-NH-Boc)80798%Pricing
BP-25669N-(Mal-PEG6)-N-bis(PEG3-Boc)Molecular structure of the compound: N-(Mal-PEG6)-N-bis(PEG3-Boc)1054.398%Pricing
BP-23730N-Mal-N-bis(PEG2-t-butyl ester)Molecular structure of the compound: N-Mal-N-bis(PEG2-t-butyl ester)600.798%Pricing
BP-23232N-Me-N-bis(PEG2-OH)Molecular structure of the compound: N-Me-N-bis(PEG2-OH)295.498%Pricing
BP-22919N-Me-N-bis(PEG3-OH)Molecular structure of the compound: N-Me-N-bis(PEG3-OH)383.598%Pricing
BP-22821N-Me-N-bis(PEG4-acid) HCl saltMolecular structure of the compound: N-Me-N-bis(PEG4-acid) HCl salt527.698%Pricing
BP-22930N-Me-N-bis(PEG2-propargyl)Molecular structure of the compound: N-Me-N-bis(PEG2-propargyl)283.498%Pricing
BP-22818N-Me-N-bis(PEG4-t-butyl ester)Molecular structure of the compound: N-Me-N-bis(PEG4-t-butyl ester)639.898%Pricing
BP-23804Bis(m-PEG4)-N-OHMolecular structure of the compound: Bis(m-PEG4)-N-OH413.598%Pricing
BP-23521N-(Azido-PEG2)-N-Fluorescein-PEG3-acidMolecular structure of the compound: N-(Azido-PEG2)-N-Fluorescein-PEG3-acid767.898%Pricing
BP-23522N-(Azido-PEG2)-N-Fluorescein-PEG4-acidMolecular structure of the compound: N-(Azido-PEG2)-N-Fluorescein-PEG4-acid811.998%Pricing
BP-23566N-(Azido-PEG3)-N-Fluorescein-PEG3-acidMolecular structure of the compound: N-(Azido-PEG3)-N-Fluorescein-PEG3-acid811.998%Pricing
BP-23278N-Biotin-N-bis(PEG4-acid)Molecular structure of the compound: N-Biotin-N-bis(PEG4-acid)739.998%Pricing
BP-23650N-(Amino-PEG4)-N-Biotin-PEG4-acidMolecular structure of the compound: N-(Amino-PEG4)-N-Biotin-PEG4-acid710.998%Pricing
BP-23574N-(Azido-PEG2)-N-Biotin-PEG3-acidMolecular structure of the compound: N-(Azido-PEG2)-N-Biotin-PEG3-acid604.798%Pricing
BP-23589N-(Azido-PEG3)-N-Biotin-PEG4-methyl esterMolecular structure of the compound: N-(Azido-PEG3)-N-Biotin-PEG4-methyl ester706.998%Pricing
BP-25141N-(DBCO-PEG4)-N-Biotin-PEG4-acidMolecular structure of the compound: N-(DBCO-PEG4)-N-Biotin-PEG4-acid998.298%Pricing
BP-24234N-(DBCO-PEG4)-N-Biotin-PEG4-NHSMolecular structure of the compound: N-(DBCO-PEG4)-N-Biotin-PEG4-NHS1095.3Pricing
BP-24519N-(DBCO-PEG4)-N-Biotin-PEG4-hydrazide TFA saltMolecular structure of the compound: N-(DBCO-PEG4)-N-Biotin-PEG4-hydrazide TFA salt1112.285%Pricing
BP-24278N-Desthiobiotin-N-bis(PEG4-NHS ester)Molecular structure of the compound: N-Desthiobiotin-N-bis(PEG4-NHS ester)90495%Pricing
BP-24280N-Desthiobiotin-N-bis(PEG4-t-butyl ester)Molecular structure of the compound: N-Desthiobiotin-N-bis(PEG4-t-butyl ester)822.197%Pricing
BP-23754N-DBCO-N-bis(PEG2-acid)Molecular structure of the compound: N-DBCO-N-bis(PEG2-acid)624.798%Pricing
BP-25448DBCO-N-bis(PEG4-acid)Molecular structure of the compound: DBCO-N-bis(PEG4-acid)800.998%Pricing
BP-23769N-DBCO-N-bis(PEG2-NHS ester)Molecular structure of the compound: N-DBCO-N-bis(PEG2-NHS ester)818.898%Pricing
BP-25449DBCO-N-bis(PEG4-NHS ester)Molecular structure of the compound: DBCO-N-bis(PEG4-NHS ester)995.195%Pricing
BP-25417Methyltetrazine-amido-N-bis(PEG4-NHS ester)Molecular structure of the compound: Methyltetrazine-amido-N-bis(PEG4-NHS ester)919.998%Pricing
BP-25624N-(TCO)-N-bis(PEG4-acid)Molecular structure of the compound: N-(TCO)-N-bis(PEG4-acid)665.898%Pricing
BP-25625N-(TCO)-N-bis(PEG4-NHS ester)Molecular structure of the compound: N-(TCO)-N-bis(PEG4-NHS ester)859.998%Pricing
BP-23579N-Benzyl-N-bis(PEG1-OH)Molecular structure of the compound: N-Benzyl-N-bis(PEG1-OH)283.498%Pricing
BP-23418N-Benzyl-N-bis(PEG3-OH)Molecular structure of the compound: N-Benzyl-N-bis(PEG3-OH)459.695%Pricing
BP-23457N-Benzyl-N-bis(PEG3-acid)Molecular structure of the compound: N-Benzyl-N-bis(PEG3-acid)515.698%Pricing
BP-23456N-Benzyl-N-bis(PEG3-t-butyl ester)Molecular structure of the compound: N-Benzyl-N-bis(PEG3-t-butyl ester)627.896%Pricing
BP-23192Acid-PEG4-S-PEG4-acidMolecular structure of the compound: Acid-PEG4-S-PEG4-acid530.698%Pricing
BP-23241Azido-PEG3-S-PEG3-azideMolecular structure of the compound: Azido-PEG3-S-PEG3-azide436.597%Pricing
BP-23193Azido-PEG3-S-PEG4-propargylMolecular structure of the compound: Azido-PEG3-S-PEG4-propargyl449.698%Pricing
BP-23190Azido-PEG3-S-PEG4-t-butyl esterMolecular structure of the compound: Azido-PEG3-S-PEG4-t-butyl ester539.798%Pricing
BP-23167m-PEG3-S-PEG2-OHMolecular structure of the compound: m-PEG3-S-PEG2-OH312.498%Pricing
BP-23166m-PEG3-S-PEG4-propargylMolecular structure of the compound: m-PEG3-S-PEG4-propargyl394.598%Pricing
BP-23152m-PEG3-S-PEG1-t-butyl esterMolecular structure of the compound: m-PEG3-S-PEG1-t-butyl ester352.598%Pricing
BP-23168m-PEG3-S-PEG3-t-butyl esterMolecular structure of the compound: m-PEG3-S-PEG3-t-butyl ester440.698%Pricing
BP-23191Propargyl-PEG4-S-PEG4-acidMolecular structure of the compound: Propargyl-PEG4-S-PEG4-acid496.698%Pricing
BP-23187Propargyl-PEG4-S-PEG4-propargylMolecular structure of the compound: Propargyl-PEG4-S-PEG4-propargyl462.698%Pricing
BP-23189Propargyl-PEG4-S-PEG4-t-butyl esterMolecular structure of the compound: Propargyl-PEG4-S-PEG4-t-butyl ester552.798%Pricing
BP-23188t-Butoxycarbonyl-PEG4-S-PEG4-t-butyl esterMolecular structure of the compound: t-Butoxycarbonyl-PEG4-S-PEG4-t-butyl ester642.998%Pricing
BP-23238Acid-PEG4-Sulfone-PEG4-acidMolecular structure of the compound: Acid-PEG4-Sulfone-PEG4-acid562.698%Pricing
BP-23236Azido-PEG3-Sulfone-PEG4-acidMolecular structure of the compound: Azido-PEG3-Sulfone-PEG4-acid515.698%Pricing
BP-23228Azide-PEG3-Sulfone-PEG3-azideMolecular structure of the compound: Azide-PEG3-Sulfone-PEG3-azide468.598%Pricing
BP-23242Azido-PEG3-Sulfone-PEG4-t-butyl esterMolecular structure of the compound: Azido-PEG3-Sulfone-PEG4-t-butyl ester571.797%Pricing
BP-23176m-PEG3-Sulfone-PEG3-acidMolecular structure of the compound: m-PEG3-Sulfone-PEG3-acid416.598%Pricing
BP-23173m-PEG3-Sulfone-PEG3-azideMolecular structure of the compound: m-PEG3-Sulfone-PEG3-azide413.598%Pricing
BP-23180m-PEG3-Sulfone-PEG2-OHMolecular structure of the compound: m-PEG3-Sulfone-PEG2-OH344.498%Pricing
BP-23179m-PEG3-Sulfone-PEG4-propargylMolecular structure of the compound: m-PEG3-Sulfone-PEG4-propargyl426.598%Pricing
BP-23175m-PEG3-Sulfone-PEG3-t-butyl esterMolecular structure of the compound: m-PEG3-Sulfone-PEG3-t-butyl ester472.696%Pricing
BP-23237Propargyl-PEG4-Sulfone-PEG4-acidMolecular structure of the compound: Propargyl-PEG4-Sulfone-PEG4-acid528.698%Pricing
BP-23229Propargyl-PEG3-Sulfone-PEG3-propargylMolecular structure of the compound: Propargyl-PEG3-Sulfone-PEG3-propargyl494.698%Pricing
BP-23230Propargyl-PEG4-Sulfone-PEG4-t-butyl esterMolecular structure of the compound: Propargyl-PEG4-Sulfone-PEG4-t-butyl ester584.798%Pricing
BP-23231t-Butyloxycarbonyl-PEG4-Sulfone-PEG4-t-butyl esterMolecular structure of the compound: t-Butyloxycarbonyl-PEG4-Sulfone-PEG4-t-butyl ester674.998%Pricing