Aliphatic Linkers

Aliphatic Linkers


Catalog Product Name Structure M.W. Purity Pricing
Amino-aliphatic-acid
BP-282379-Aminononanoic acidMolecular structure of the compound: 9-Aminononanoic acid173.3Pricing
BP-2823610-Aminodecanoic acidMolecular structure of the compound: 10-Aminodecanoic acid187.3Pricing
BP-28235Aminoundecanoic acidMolecular structure of the compound: Aminoundecanoic acid201.3Pricing
BP-2823412-Aminododecanoic acidMolecular structure of the compound: 12-Aminododecanoic acid215.3Pricing
BP-2823315-Aminopentadecanoic AcidMolecular structure of the compound: 15-Aminopentadecanoic Acid257.4Pricing
BP-2823216-Aminohexadecanoic acidMolecular structure of the compound: 16-Aminohexadecanoic acid271.4Pricing
Amino-aliphatic-amine
BP-262771,3-DiaminopropaneMolecular structure of the compound: 1,3-Diaminopropane74.1Pricing
Amino-aliphatic-aminooxy
BP-25154t-Boc-Aminooxy-pentane-amineMolecular structure of the compound: t-Boc-Aminooxy-pentane-amine218.398%Pricing
Amino-aliphatic-azide
BP-251233-azidopropan-1-amineMolecular structure of the compound: 3-azidopropan-1-amine100.1Pricing
BP-296734-Azidobutan-1-amineMolecular structure of the compound: 4-Azidobutan-1-amine114.2Pricing
BP-251575-azidopentan-1-amineMolecular structure of the compound: 5-azidopentan-1-amine128.298%Pricing
BP-239656-AZIDOHEXAN-1-AMINEMolecular structure of the compound: 6-AZIDOHEXAN-1-AMINE142.295%Pricing
Amino-aliphatic-t-Boc
BP-31035N-Boc-EthylenediamineMolecular structure of the compound: N-Boc-Ethylenediamine160.2Pricing
BP-31125tert-Butyl (3-aminopropyl)carbamateMolecular structure of the compound: tert-Butyl (3-aminopropyl)carbamate174.2Pricing
BP-28264tert-Butyl (5-aminopentyl)carbamateMolecular structure of the compound: tert-Butyl (5-aminopentyl)carbamate202.3Pricing
BP-28263tert-Butyl (7-aminoheptyl)carbamateMolecular structure of the compound: tert-Butyl (7-aminoheptyl)carbamate230.4Pricing
BP-28262tert-butyl (8-aminooctyl)carbamateMolecular structure of the compound: tert-butyl (8-aminooctyl)carbamate244.4Pricing
BP-28261tert-Butyl (9-aminononyl)carbamateMolecular structure of the compound: tert-Butyl (9-aminononyl)carbamate258.4Pricing
BP-28260tert-Butyl (10-aminodecyl)carbamateMolecular structure of the compound: tert-Butyl (10-aminodecyl)carbamate272.4Pricing
BP-28259tert-Butyl (11-aminoundecyl)carbamateMolecular structure of the compound: tert-Butyl (11-aminoundecyl)carbamate286.5Pricing
BP-28258tert-Butyl (12-aminododecyl)carbamateMolecular structure of the compound: tert-Butyl (12-aminododecyl)carbamate300.5Pricing
Amino-aliphatic-alcohol
BP-31055EthanolamineMolecular structure of the compound: Ethanolamine61.1Pricing
BP-310413-Amino-1-propanolMolecular structure of the compound: 3-Amino-1-propanol75.1Pricing
BP-254785-Amino-1-pentanolMolecular structure of the compound: 5-Amino-1-pentanol103.2Pricing
BP-311696-Amino-1-hexanolMolecular structure of the compound: 6-Amino-1-hexanol117.2Pricing
Bis-aliphatic-acid
BP-21128SUCCINIC ACIDMolecular structure of the compound: SUCCINIC ACID118.199%Pricing
BP-21143GLUTARIC ACIDMolecular structure of the compound: GLUTARIC ACID132.199%Pricing
BP-30248Adipic acidMolecular structure of the compound: Adipic acid146.195%Pricing
BP-21136PIMELIC ACIDMolecular structure of the compound: PIMELIC ACID160.298%Pricing
BP-27862Suberic acidMolecular structure of the compound: Suberic acid174.298%Pricing
BP-27863Azelaic acidMolecular structure of the compound: Azelaic acid188.298%Pricing
BP-27864Decanedioic acidMolecular structure of the compound: Decanedioic acid202.395%Pricing
Bis-aliphatic-NHS ester
BP-22659DSG CrosslinkerMolecular structure of the compound: DSG Crosslinker326.397%Pricing
BP-22656DSS CrosslinkerMolecular structure of the compound: DSS Crosslinker368.397%Pricing
t-butyl-aliphatic-acid
BP-2439310-(tert-Butoxy)-10-oxodecanoic acidMolecular structure of the compound: 10-(tert-Butoxy)-10-oxodecanoic acid258.4Pricing
BP-24391tert-Butyl Hydrogen TetradecanedioateMolecular structure of the compound: tert-Butyl Hydrogen Tetradecanedioate314.595%Pricing
BP-2435418-(tert-Butoxy)-18-oxooctadecanoic acid)Molecular structure of the compound: 18-(tert-Butoxy)-18-oxooctadecanoic acid)370.6Pricing
BP-2799320-(tert-Butoxy)-20-oxoicosanoic acidMolecular structure of the compound: 20-(tert-Butoxy)-20-oxoicosanoic acid398.698%Pricing
t-butyl-aliphatic-NHS ester
BP-244056-(tert-Butoxy)-6-oxohexanoic NHS esterMolecular structure of the compound: 6-(tert-Butoxy)-6-oxohexanoic NHS ester299.398%Pricing
BP-2440610-(tert-Butoxy)-10-oxodecanoic NHS esterMolecular structure of the compound: 10-(tert-Butoxy)-10-oxodecanoic NHS ester355.498%Pricing
BP-24365t-butyl-octadecanedioate-NHS esterMolecular structure of the compound: t-butyl-octadecanedioate-NHS ester467.795%Pricing
t-Boc-aliphatic-acid
BP-28247Boc-beta-Ala-OHMolecular structure of the compound: Boc-beta-Ala-OH189.2Pricing
BP-26122N-Boc-4-aminobutyric AcidMolecular structure of the compound: N-Boc-4-aminobutyric Acid203.298%Pricing
BP-28246Boc-5-aminopentanoic acidMolecular structure of the compound: Boc-5-aminopentanoic acid217.3Pricing
BP-28245Boc-6-aminohexanoic acidMolecular structure of the compound: Boc-6-aminohexanoic acid231.3Pricing
BP-28244Boc-7-Aminoheptanoic acidMolecular structure of the compound: Boc-7-Aminoheptanoic acid245.3Pricing
BP-28243Boc-8-aoc-ohMolecular structure of the compound: Boc-8-aoc-oh259.3Pricing
BP-282429-(Boc-amino)nonanoic AcidMolecular structure of the compound: 9-(Boc-amino)nonanoic Acid273.4Pricing
BP-28241Boc-10-Aminodecanoic acidMolecular structure of the compound: Boc-10-Aminodecanoic acid287.4Pricing
BP-28240Boc-11-aminoundecanoic acidMolecular structure of the compound: Boc-11-aminoundecanoic acid301.4Pricing
BP-28239Boc-12-Ado-OHMolecular structure of the compound: Boc-12-Ado-OH315.5Pricing
BP-28238N-Boc-15-aminopentadecanoic acidMolecular structure of the compound: N-Boc-15-aminopentadecanoic acid357.5Pricing
BP-2978516-(tert-Butoxy)-16-oxohexadecanoic acidMolecular structure of the compound: 16-(tert-Butoxy)-16-oxohexadecanoic acid342.598%Pricing
t-Boc-aliphatic-NHS ester
BP-29301Boc-5-aminopentanoic NHS esterMolecular structure of the compound: Boc-5-aminopentanoic NHS ester314.398%Pricing
t-Boc-aliphatic-Mal
BP-20992tert-butyl 2-(2,5-dioxo-2H-pyrrol-1(5H)-yl)ethylcarbamateMolecular structure of the compound: tert-butyl 2-(2,5-dioxo-2H-pyrrol-1(5H)-yl)ethylcarbamate240.395%Pricing
BP-20987tert-butyl 6-(2,5-dioxo-2H-pyrrol-1(5H)-yl)hexylcarbamateMolecular structure of the compound: tert-butyl 6-(2,5-dioxo-2H-pyrrol-1(5H)-yl)hexylcarbamate296.496%Pricing
t-Boc-aliphatic-alcohol
BP-312123-(Boc-amino)-1-propanolMolecular structure of the compound: 3-(Boc-amino)-1-propanol175.2Pricing
BP-254775-(Boc-amino)-1-pentanolMolecular structure of the compound: 5-(Boc-amino)-1-pentanol203.3Pricing
t-Boc-aliphatic-Tos
BP-283915-((tert-Butoxycarbonyl)amino)pentyl 4-methylbenzenesulfonateMolecular structure of the compound: 5-((tert-Butoxycarbonyl)amino)pentyl 4-methylbenzenesulfonate357.5Pricing
BP-284036-((tert-Butoxycarbonyl)amino)hexyl 4-methylbenzenesulfonateMolecular structure of the compound: 6-((tert-Butoxycarbonyl)amino)hexyl 4-methylbenzenesulfonate371.5Pricing
Fmoc-aliphatic-acid
BP-28256Fmoc-4-aminobutanoic acidMolecular structure of the compound: Fmoc-4-aminobutanoic acid325.4Pricing
BP-28255Fmoc-5-aminopentanoic acidMolecular structure of the compound: Fmoc-5-aminopentanoic acid339.4Pricing
BP-28254Fmoc-6-aminohexanoic acidMolecular structure of the compound: Fmoc-6-aminohexanoic acid353.4Pricing
BP-28253Fmoc-7-amino-heptanoic acidMolecular structure of the compound: Fmoc-7-amino-heptanoic acid367.4Pricing
BP-28252N-Fmoc-8-aminooctanoic acidMolecular structure of the compound: N-Fmoc-8-aminooctanoic acid381.5Pricing
BP-28251Fmoc-9-aminononanoic acidMolecular structure of the compound: Fmoc-9-aminononanoic acid395.5Pricing
BP-28250Fmoc-11-aminoundecanoic acidMolecular structure of the compound: Fmoc-11-aminoundecanoic acid423.6Pricing
BP-28249Fmoc-12-aminododecanoic acidMolecular structure of the compound: Fmoc-12-aminododecanoic acid437.6Pricing
BP-2824814-(Fmoc-amino)-tetradecanoic acidMolecular structure of the compound: 14-(Fmoc-amino)-tetradecanoic acid465.6Pricing
Mal-aliphatic-acid
BP-297862-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)acetic acidMolecular structure of the compound: 2-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)acetic acid155.197%Pricing
BP-204523-Maleimidopropionic acidMolecular structure of the compound: 3-Maleimidopropionic acid169.198%Pricing
BP-219994-(2,5-dioxo-2H-pyrrol-1(5H)-yl)butanoic acidMolecular structure of the compound: 4-(2,5-dioxo-2H-pyrrol-1(5H)-yl)butanoic acid183.296%Pricing
BP-235455-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)pentanoic acidMolecular structure of the compound: 5-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)pentanoic acid197.298%Pricing
BP-204156-Maleimidocaproic acidMolecular structure of the compound: 6-Maleimidocaproic acid211.298%Pricing
Mal-aliphatic-NHS ester
BP-28415N-(alfa-Maleimidoacetoxy)succinimideMolecular structure of the compound: N-(alfa-Maleimidoacetoxy)succinimide252.2Pricing
BP-205093-Maleimido-propionic NHS esterMolecular structure of the compound: 3-Maleimido-propionic NHS ester266.298%Pricing
BP-312322,5-Dioxopyrrolidin-1yl 4-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)butanoateMolecular structure of the compound: 2,5-Dioxopyrrolidin-1yl 4-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)butanoate280.2Pricing
BP-243605-Maleimido-pentanoic NHS esterMolecular structure of the compound: 5-Maleimido-pentanoic NHS ester294.398%Pricing
BP-204006-Maleimido-hexanoic NHS esterMolecular structure of the compound: 6-Maleimido-hexanoic NHS ester308.398%Pricing
BP-22646SMPH CrosslinkerMolecular structure of the compound: SMPH Crosslinker379.497%Pricing
BP-204166-Maleimidocaproic acid PFP esterMolecular structure of the compound: 6-Maleimidocaproic acid PFP ester377.396%Pricing
Mal-aliphatic-amine
BP-20991N-(2-Aminoethyl)maleimide TFA saltMolecular structure of the compound: N-(2-Aminoethyl)maleimide TFA salt140.195%Pricing
BP-20986Mal-C6-amine TFA saltMolecular structure of the compound: Mal-C6-amine TFA salt196.395%Pricing
Mal-aliphatic-alcohol
BP-263501-(2-hydroxymethyl)-1-H-pyrrole-2,5-dioneMolecular structure of the compound: 1-(2-hydroxymethyl)-1-H-pyrrole-2,5-dione141.1Pricing
Propargyl-aliphatic-acid
BP-311685-Hexynoic acidMolecular structure of the compound: 5-Hexynoic acid98.1Pricing
BP-296836-Heptynoic acidMolecular structure of the compound: 6-Heptynoic acid126.2Pricing
BP-283858-NonynoicacidMolecular structure of the compound: 8-Nonynoicacid154.2Pricing
BP-23393Alkynyl Myristic AcidMolecular structure of the compound: Alkynyl Myristic Acid224.395%Pricing
BP-23392Alkynyl Palmitic AcidMolecular structure of the compound: Alkynyl Palmitic Acid252.495%Pricing
BP-23391Alkynyl Stearic AcidMolecular structure of the compound: Alkynyl Stearic Acid280.595%Pricing
Propargyl-aliphatic-NHS ester
BP-284204-Pentynoic acid succinimidyl esterMolecular structure of the compound: 4-Pentynoic acid succinimidyl ester195.2Pricing
BP-244615-Hexynoic Acid-NHS EsterMolecular structure of the compound: 5-Hexynoic Acid-NHS Ester209.298%Pricing
BP-283892,5-Dioxopyrrolidin-1-yl hept-6-ynoateMolecular structure of the compound: 2,5-Dioxopyrrolidin-1-yl hept-6-ynoate223.2Pricing
Propargyl-aliphatic-STP ester
BP-28994Pentynoic acid STP esterMolecular structure of the compound: Pentynoic acid STP ester325.2Pricing
BP-28993Hexynoic acid STP esterMolecular structure of the compound: Hexynoic acid STP ester339.2Pricing
Propargyl-aliphatic-maleimide
BP-28991Alkyne maleimideMolecular structure of the compound: Alkyne maleimide234.3Pricing
Propargyl-aliphatic-bromide
BP-283888-Bromooct-1-yneMolecular structure of the compound: 8-Bromooct-1-yne189.1Pricing
Propargyl-aliphatic-Tos
BP-28386Hept-6-yn-1-yl 4-methylbenzenesulfonateMolecular structure of the compound: Hept-6-yn-1-yl 4-methylbenzenesulfonate266.4Pricing
Propargyl-aliphatic-t-Boc
BP-28405tert-Butyl oct-7-yn-1-ylcarbamateMolecular structure of the compound: tert-Butyl oct-7-yn-1-ylcarbamate225.3Pricing
Propargyl-aliphatic-alcohol
BP-310763-Butyn-1-olMolecular structure of the compound: 3-Butyn-1-ol70.1Pricing
BP-296667-Octyn-1-olMolecular structure of the compound: 7-Octyn-1-ol126.2Pricing
Propargyl-aliphatic-hydrazide
BP-28990Alkyne hydrazideMolecular structure of the compound: Alkyne hydrazide127.2Pricing
Propargyl-aliphatic-isoindole-1,3-dione
BP-296612-(7-Octyn-1-yl)-1H-isoindole-1,3-dioneMolecular structure of the compound: 2-(7-Octyn-1-yl)-1H-isoindole-1,3-dione255.3Pricing
Azido-aliphatic-acid
BP-238762-Azidoacetic AcidMolecular structure of the compound: 2-Azidoacetic Acid101.197%Pricing
BP-238754-azidobutyric acidMolecular structure of the compound: 4-azidobutyric acid129.198%Pricing
BP-310685-azidopentanoic acidMolecular structure of the compound: 5-azidopentanoic acid143.195%Pricing
BP-254466-Azido-hexanoic acidMolecular structure of the compound: 6-Azido-hexanoic acid157.297%Pricing
BP-2547011-Azidoundecanoic acidMolecular structure of the compound: 11-Azidoundecanoic acid227.3Pricing
Azido-aliphatic-NHS ester
BP-22526Azidobutyric acid NHS esterMolecular structure of the compound: Azidobutyric acid NHS ester226.296%Pricing
BP-296945-Azidopentanoic acid N-hydroxysuccinimide esterMolecular structure of the compound: 5-Azidopentanoic acid N-hydroxysuccinimide ester240.2Pricing
BP-25454Azido-Aca-NHSMolecular structure of the compound: Azido-Aca-NHS254.297%Pricing
BP-254682,5-Dioxo-1-pyrrolidinyl 11-azidoundecanoateMolecular structure of the compound: 2,5-Dioxo-1-pyrrolidinyl 11-azidoundecanoate324.4Pricing
Azido-aliphatic-ethyl ester
BP-29695Ethyl 3-azidopropanoateMolecular structure of the compound: Ethyl 3-azidopropanoate143.1Pricing
BP-29696Ethyl 4-azidobutyrateMolecular structure of the compound: Ethyl 4-azidobutyrate157.2Pricing
BP-296935-Azidopentanoic acid ethyl esterMolecular structure of the compound: 5-Azidopentanoic acid ethyl ester171.2Pricing
BP-29697Ethyl 6-azidohexanoateMolecular structure of the compound: Ethyl 6-azidohexanoate185.2Pricing
Azido-aliphatic-amine
BP-251233-azidopropan-1-amineMolecular structure of the compound: 3-azidopropan-1-amine100.1Pricing
BP-296734-Azidobutan-1-amineMolecular structure of the compound: 4-Azidobutan-1-amine114.2Pricing
BP-251575-azidopentan-1-amineMolecular structure of the compound: 5-azidopentan-1-amine128.298%Pricing
BP-239656-AZIDOHEXAN-1-AMINEMolecular structure of the compound: 6-AZIDOHEXAN-1-AMINE142.295%Pricing
t-Boc-aliphatic-azide
BP-29670tert-Butyl (3-azidopropyl)carbamateMolecular structure of the compound: tert-Butyl (3-azidopropyl)carbamate200.2Pricing
BP-29699tert-Butyl N-(4-azidobutyl)carbamateMolecular structure of the compound: tert-Butyl N-(4-azidobutyl)carbamate214.3Pricing
Azido-aliphatic-amiooxy
BP-25153t-Boc-Aminooxy-pentane-azideMolecular structure of the compound: t-Boc-Aminooxy-pentane-azide244.398%Pricing
Azido-aliphatic-azide
BP-251481,5-diazidopentaneMolecular structure of the compound: 1,5-diazidopentane154.295%Pricing
Azido-aliphatic-alcohol
BP-263513-Azido-alcoholMolecular structure of the compound: 3-Azido-alcohol101.195%Pricing
BP-296924-Azidobutan-1-olMolecular structure of the compound: 4-Azidobutan-1-ol115.1Pricing
BP-251495-azidopentan-1-olMolecular structure of the compound: 5-azidopentan-1-ol129.295%Pricing
BP-2968811-azido-1-undecanolMolecular structure of the compound: 11-azido-1-undecanol213.3Pricing
Azido-aliphatic-benzoate
BP-296744-Azidobutyl benzoateMolecular structure of the compound: 4-Azidobutyl benzoate219.2Pricing
Azido-aliphatic-methoxybenzene
BP-296861-((4-Azidobutoxy)methyl)-4-methoxybenzeneMolecular structure of the compound: 1-((4-Azidobutoxy)methyl)-4-methoxybenzene235.3Pricing
Azido-aliphatic-isoindoline-1,3-dione
BP-296592-(5-Azidopentyl)isoindoline-1,3-dioneMolecular structure of the compound: 2-(5-Azidopentyl)isoindoline-1,3-dione258.3Pricing
BP-296602-(6-Azidohexyl)isoindoline-1,3-dioneMolecular structure of the compound: 2-(6-Azidohexyl)isoindoline-1,3-dione272.3Pricing
Azido-aliphatic-tosyl
BP-25152Tos-pentane-azideMolecular structure of the compound: Tos-pentane-azide283.498%Pricing
Azido-aliphatic-t-butyldimethylsilane
BP-29685[(5-Azidopentyl)oxy](tert-butyl)dimethylsilaneMolecular structure of the compound: [(5-Azidopentyl)oxy](tert-butyl)dimethylsilane243.4Pricing
Azido-aliphatic-biotin
BP-296645-(Biotinamido)butyllazideMolecular structure of the compound: 5-(Biotinamido)butyllazide340.5Pricing
BP-296815-(Biotinamido)pentylazideMolecular structure of the compound: 5-(Biotinamido)pentylazide354.5Pricing
BP-296826-(Biotinamido)hexylazideMolecular structure of the compound: 6-(Biotinamido)hexylazide368.5Pricing
Azido-aliphatic-acetyl chloride
BP-296913-Azidopropanoyl chloride 10% in MTBEMolecular structure of the compound: 3-Azidopropanoyl chloride 10% in MTBE133.5Pricing
Azido-aliphatic-isoindole-1,3-dione
BP-296892-(3-azidopropyl)-isoindole-1,3-dioneMolecular structure of the compound: 2-(3-azidopropyl)-isoindole-1,3-dione230.2Pricing
BP-296902-(4-Azidobutyl)isoindoline-1,3-dioneMolecular structure of the compound: 2-(4-Azidobutyl)isoindoline-1,3-dione244.3Pricing
Bromo-aliphatic-acid
BP-311497-Bromoheptanoic acidMolecular structure of the compound: 7-Bromoheptanoic acid209.1Pricing
BP-3114810-Bromodecanoic acidMolecular structure of the compound: 10-Bromodecanoic acid251.2Pricing
Bromo-aliphatic-bromide
BP-311901,3-DibromopropaneMolecular structure of the compound: 1,3-Dibromopropane201.9Pricing
Bromo-aliphatic-alcohol
BP-311891,3-DibromopropaneMolecular structure of the compound: 1,3-Dibromopropane201.9Pricing
Bromo-aliphatic-acetyl chloride
BP-311748-bromooctanoyl chlorideMolecular structure of the compound: 8-bromooctanoyl chloride241.6Pricing
Thiol-aliphatic-NHS ester
BP-2965311-Mercaptoundecanoic acid 2,5-dioxo-1-pyrrolidinyl esterMolecular structure of the compound: 11-Mercaptoundecanoic acid 2,5-dioxo-1-pyrrolidinyl ester315.4Pricing
Hydroxy-aliphatic-Tos
BP-283926-Hydroxyhexyl 4-methylbenzenesulfonateMolecular structure of the compound: 6-Hydroxyhexyl 4-methylbenzenesulfonate272.4Pricing
t-butyl-aliphatic-alcohol
BP-278614-Hydroxy-butyric acid tert-butyl esterMolecular structure of the compound: 4-Hydroxy-butyric acid tert-butyl ester160.2Pricing
BP-28094tert-butyl 6-hydroxyhexanoateMolecular structure of the compound: tert-butyl 6-hydroxyhexanoate188.3Pricing
BP-28093tert-butyl 7-hydroxyheptanoateMolecular structure of the compound: tert-butyl 7-hydroxyheptanoate202.3Pricing
t-butyl-aliphatic-methyl ester
BP-29671tert-Butyl methyl adipateMolecular structure of the compound: tert-Butyl methyl adipate216.3Pricing
Iodoacetamide-aliphatic-azide
BP-28101Iodoacetamide AzideMolecular structure of the compound: Iodoacetamide Azide268.1Pricing
Hydroxyl-aliphatic-iodide
BP-296656-Iodohexan-1-olMolecular structure of the compound: 6-Iodohexan-1-ol228.1Pricing
BP-296678-Iodooct-7-yn-1-olMolecular structure of the compound: 8-Iodooct-7-yn-1-ol252.1Pricing
t-boc-aliphatic-iodide
BP-29680tert-Butyl 3-iodopropylcarbamateMolecular structure of the compound: tert-Butyl 3-iodopropylcarbamate285.1Pricing
BP-28393tert-Butyl (4-iodobutyl)carbamateMolecular structure of the compound: tert-Butyl (4-iodobutyl)carbamate299.2Pricing
BP-28398tert-Butyl (6-iodohexyl)carbamateMolecular structure of the compound: tert-Butyl (6-iodohexyl)carbamate327.2Pricing
Benzoate-aliphatic-iodide
BP-296634-Iodobutyl benzoateMolecular structure of the compound: 4-Iodobutyl benzoate304.1Pricing
t-butyldimethylsilane-aliphatic-iodide
BP-29684(1,1-Dimethylethyl)[(5-iodopentyl)oxy]dimethylsilaneMolecular structure of the compound: (1,1-Dimethylethyl)[(5-iodopentyl)oxy]dimethylsilane328.3Pricing
t-boc-aliphatic-chloride
BP-29679tert-Butyl (3-chloropropyl)carbamateMolecular structure of the compound: tert-Butyl (3-chloropropyl)carbamate193.7Pricing
Chloro-aliphatic-silane
BP-296764-Chlorobutoxy(trimethyl)silaneMolecular structure of the compound: 4-Chlorobutoxy(trimethyl)silane180.8Pricing
Chloro-aliphatic-isoindole-1,3(2H)-dione
BP-296582-(3-Chloropropyl)-1H-isoindole-1,3(2H)-dioneMolecular structure of the compound: 2-(3-Chloropropyl)-1H-isoindole-1,3(2H)-dione223.7Pricing
Cbz-N-Amido-aliphatic-acid
BP-28400N-Cbz-7-aminoheptanoic acidMolecular structure of the compound: N-Cbz-7-aminoheptanoic acid279.3Pricing
Benzyloxy-aliphatic-aldehyde
BP-296754-BenzyloxybutanalMolecular structure of the compound: 4-Benzyloxybutanal178.2Pricing
Cbz-N-Amido-aliphatic-aldehyde
BP-28383Benzyl (6-oxohexyl)carbamateMolecular structure of the compound: Benzyl (6-oxohexyl)carbamate249.3Pricing
Cbz-N-Amido-aliphatic-alcohol
BP-28384Benzyl (5-hydroxypentyl)carbamateMolecular structure of the compound: Benzyl (5-hydroxypentyl)carbamate237.3Pricing
Hydroxyl-aliphatic-methoxyphenyl
BP-296724-[(4-Methoxyphenyl)methoxy]butan-1-olMolecular structure of the compound: 4-[(4-Methoxyphenyl)methoxy]butan-1-ol210.3Pricing